<- User:Beetstra/listing8 - User:Beetstra/Validation - User:Beetstra/listing10 ->

Data

2001 to 2050

Bexlosteride (2002)
```
Botcommand: addindex 356739207 Bexlosteride
```
```
For index : Bexlosteride=356739207
```
* 202189-78-4 -> 202189-78-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Bexlosteride not found on commonchemistry - Bexlosteride

* No ChemSpiderID

* PubChem: 166562

* No InChI

* No SMILES
Biapenem (2005)
```
Botcommand: addindex 334306234 Biapenem
```
```
For index : Biapenem=334306234
```
* 120410-24-4 -> 120410-24-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Biapenem not found on commonchemistry - Biapenem

* No ChemSpiderID

* PubChem: 71339

* No InChI

* No SMILES
Bibrocathol (2007)
```
Botcommand: addindex 356062237 Bibrocathol
```
```
For index : Bibrocathol=356062237
```
* 6915-57-7 -> 6915-57-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Bibrocathol not found on commonchemistry - Bibrocathol

* ChemSpiderID: 11232581 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 16683103

* No InChI - (ChemSpider: | InChI=InChI=1/C6H2Br4O2.Bi.H2O/c7-1-2(8)4(10)6(12)5(11)3(1)9;;/h11-12H;;1H2/q; 3;/p-3/rC6HBiBr4O3/c8-1-2(9)4(11)6-5(3(1)10)13-7(12)14-6/h12H )

* No SMILES - (ChemSpider: | smiles=O[Bi]1Oc2c(Br)c(Br)c(Br)c(Br)c2O1 )
Bicifadine (2009)
```
Botcommand: addindex 353411484 Bicifadine
```
```
For index : Bicifadine=353411484
```
* 71195-57-8 -> 71195-57-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Bicifadine not found on commonchemistry - Bicifadine

* No ChemSpiderID

* PubChem: 47953

* No InChI

* No SMILES
Bicinchoninic_acid (2010)
```
Botcommand: addindex 345799674 Bicinchoninic_acid
```
```
For index : Bicinchoninic_acid=345799674
```
* 1245-13-2 -> 1245-13-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Bicinchoninic acid not found on commonchemistry - Bicinchoninic acid

* ChemSpiderID: 64223 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 71068

* InChI: 1/C20H12N2O4/c23-19(24)13-9-17(21-15-7-3-1-5-11(13)15)18-10-14(20(25)26)12-6-2-4-8-16(12)22-18/h1-10H,(H,23,24)(H,25,26) - (ChemSpider: | InChI=InChI=1/C20H12N2O4/c23-19(24)13-9-17(21-15-7-3-1-5-11(13)15)18-10-14(20(25)26)12-6-2-4-8-16(12)22-18/h1-10H,(H,23,24)(H,25,26) )

* SMILES: O=C(O)c1cc(nc2c1cccc2)c3nc4ccccc4c(c3)C(=O)O - (ChemSpider: | SMILES=O=C(O)c1cc(nc2c1cccc2)c3nc4ccccc4c(c3)C(=O)O )
Bicine (2011)
```
Botcommand: addindex 310330999 Bicine
```
```
For index : Bicine=310330999
```
* 150-25-4 -> 150-25-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Bicine found on commonchemistry - Bicine
* 20830-81-3 (Formula: C27H29NO10; Name: 5,12-Naphthacenedione, 8-acetyl-10-[(3-amino-2,3,6-trideoxy-Î±-L-lyxo-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-1-methoxy-, (8S,10S)-)

* 23214-92-8 (Formula: C27H29NO11; Name: 5,12-Naphthacenedione, 10-[(3-amino-2,3,6-trideoxy-Î±-L-lyxo-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-8-(hydroxyacetyl)-1-methoxy-, (8S,10S)-)

* 56420-45-2 (Formula: C27H29NO11; Name: 5,12-Naphthacenedione, 10-[(3-amino-2,3,6-trideoxy-Î±-L-arabino-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-8-(hydroxyacetyl)-1-methoxy-, (8S,10S)-)

* No ChemSpiderID

* PubChem: 8761

* No InChI

* SMILES: C(CO)N(CCO)CC(=O)O
Bicyclopropenyl (2014)

* No CASNo

* Bicyclopropenyl not found on commonchemistry - Bicyclopropenyl

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Biebrich_scarlet (2015)
```
Botcommand: addindex 343394346 Biebrich_scarlet
```
```
For index : Biebrich_scarlet=343394346
```
* 4196-99-0 -> 4196-99-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Biebrich scarlet not found on commonchemistry - Biebrich scarlet

* ChemSpiderID: 17967084 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 8630755

* InChI: 1/C22H16N4O7S2.2Na/c27-20-12-5-14-3-1-2-4-18(14)22(20)26-25-19-11-8-16(13-21(19)35(31,32)33)24-23-15-6-9-17(10-7-15)34(28,29)30;;/h1-13,27H,(H,28,29,30)(H,31,32,33);;/q;2* 1/p-2 - (ChemSpider: | InChI=InChI=1/C22H16N4O7S2.2Na/c27-20-12-5-14-3-1-2-4-18(14)22(20)26-25-19-11-8-16(13-21(19)35(31,32)33)24-23-15-6-9-17(10-7-15)34(28,29)30;;/h1-13,27H,(H,28,29,30)(H,31,32,33);;/q;2* 1/p-2 )

* SMILES: [Na ].[Na ].[O-]S(=O)(=O)c1ccc(cc1)/N=N/c4ccc(/N=N/c2c3ccccc3ccc2O)c(c4)S([O-])(=O)=O - (ChemSpider: | SMILES=[Na ].[Na ].[O-]S(=O)(=O)c1ccc(cc1)/N=N/c4ccc(/N=N/c2c3ccccc3ccc2O)c(c4)S([O-])(=O)=O )
Bietaserpine (2016)

* No CASNo

* Bietaserpine not found on commonchemistry - Bietaserpine

* No ChemSpiderID

* PubChem: 65518

* No InChI

* SMILES: CCN(CC)CCN1C2=C(C=CC(=C2)OC)C3=C1C4CC5C(CC(C(C5C(=O)OC)OC)OC(=O)C6=CC(=C(C(=C6)OC)OC)OC)CN4CC3
Bifemelane (2017)
```
Botcommand: addindex 346048731 Bifemelane
```
```
For index : Bifemelane=346048731
```
* 90293-01-9 -> 90293-01-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Bifemelane not found on commonchemistry - Bifemelane

* No ChemSpiderID

* PubChem: 2377

* No InChI

* No SMILES
Big_gastrin (2021)
```
Botcommand: addindex 314342531 Big_gastrin
```
```
For index : Big_gastrin=314342531
```
* 53988-98-0 -> 53988-98-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Big gastrin not found on commonchemistry - Big gastrin

* No ChemSpiderID

* PubChem: 16132306

* No InChI

* SMILES: C[C@@H](C(=O)NCC(=O)NCC(=O)N[C@@H](CC1=CNC2=CC=CC=C21)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC3=CC=CC=C3)C(=O)N)NC(=O)CNC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)CNC(=O)CNC(=O)[C@@H]4CCCN4C(=O)CNC(=O)[C@H](CCC(=O)N)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)CNC(=O)CNC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)CNC(=O)CNC(=O)CNC(=O)CNC(=O)[C@@H]5CCCN5C(=O)CNC(=O)[C@H](CCC(=O)N)NC(=O)CNC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@@H]6CCC(=O)N6
Bilirubin (2023)
```
Botcommand: addindex 364801159 Bilirubin
```
```
For index : Bilirubin=364801159
```
* 635-65-4 -> 635-65-4 - NOT VERIFIED

* CAS found on commonchemistry - 635-65-4 - name in list
All names: (4Z,15Z)-Bilirubin IXÎ±, (Z,Z)-Bilirubin, (Z,Z)-Bilirubin IXÎ±, 21H-Biline-8,12-dipropanoic acid, 2,17-diethenyl-1,10,19,22,23,24-hexahydro-3,7,13,18-tetramethyl-1,19-dioxo-, 21H-Biline-8,12-dipropanoic acid, 2,17-diethenyl-1,10,19,22,23,24-hexahydro-3,7,13,18-tetramethyl-1,19-dioxo-, Biline-8,12-dipropionic acid, 1,10,19,22,23,24-hexahydro-2,7,13,17-tetramethyl-1,19-dioxo-3,18-divinyl-, bilirubin, Bilirubin IXÎ±, BILIRUBIN POWDER, bilirubina, Bilirubine, Cholerythrin, Hematoidin, NSC 26685

* Bilirubin found on commonchemistry - Bilirubin
* 635-65-4 (Formula: C33H36N4O6; Name: 21H-Biline-8,12-dipropanoic acid, 2,17-diethenyl-1,10,19,22,23,24-hexahydro-3,7,13,18-tetramethyl-1,19-dioxo-) Matches CAS (635-65-4) on page

* 114-25-0 (Formula: C33H34N4O6; Name: 21H-Biline-8,12-dipropanoic acid, 3,18-diethenyl-1,19,22,24-tetrahydro-2,7,13,17-tetramethyl-1,19-dioxo-)

* No ChemSpiderID

* PubChem: 250

* InChI: <small>1/C33H36N4O6/c1-7-20-19(6)32(42)37-27(20)14-25-18(5)23(10-12-31(40)41)29(35-25)15-28-22(9-11-30(38)39)17(4)24(34-28)13-26-16(3)21(8-2)33(43)36-26/h7-8,13-14,34-35H,1-2,9-12,15H2,3-6H3,(H,36,43)(H,37,42)(H,38,39)(H,40,41)/f/h36-38,40H</small>

* SMILES: CC1=C(NC(=C1CCC(=O)O)CC2=C(C(=C(N2)C=C3C(=C(C(=O)N3)C)C=C)C)CCC(=O)O)C=C4C(=C(C(=O)N4)C=C)C
Bilirubin_diglucuronide (2024)
```
Botcommand: addindex 344907575 Bilirubin_diglucuronide
```
```
For index : Bilirubin_diglucuronide=344907575
```
* 17459-92-6 -> 17459-92-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Bilirubin diglucuronide not found on commonchemistry - Bilirubin diglucuronide

* No ChemSpiderID

* PubChem: 5280817

* No InChI

* No SMILES
Bilobalide (2026)
```
Botcommand: addindex 360229461 Bilobalide
```
```
For index : Bilobalide=360229461
```
* 33570-04-6 -> 33570-04-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Bilobalide not found on commonchemistry - Bilobalide

* No ChemSpiderID

* PubChem: 73581

* No InChI

* No SMILES
Binapacryl (2028)
```
Botcommand: addindex 340552634 Binapacryl
```
```
For index : Binapacryl=340552634
```
* 485-31-4 -> 485-31-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Binapacryl not found on commonchemistry - Binapacryl

* No ChemSpiderID

* PubChem: 10234

* No InChI

* SMILES: CCC(C)C1=CC(=CC(=C1OC(=O)C=C(C)C)[N ](=O)[O-])[N ](=O)[O-]
Binedaline (2029)
```
Botcommand: addindex 350732566 Binedaline
```
```
For index : Binedaline=350732566
```
* 60662-16-0 -> 60662-16-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Binedaline not found on commonchemistry - Binedaline

* ChemSpiderID: 38769 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 42509

* No InChI - (ChemSpider: | InChI=InChI=1/C19H23N3/c1-20(2)13-14-21(3)22-15-18(16-9-5-4-6-10-16)17-11-7-8-12-19(17)22/h4-12,15H,13-14H2,1-3H3 )

* No SMILES - (ChemSpider: | smiles=c1cccc2c1c(cn2N(CCN(C)C)C)c3ccccc3 )
Binospirone (2030)
```
Botcommand: addindex 352889932 Binospirone
```
```
For index : Binospirone=352889932
```
* 124756-23-6 -> 124756-23-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Binospirone not found on commonchemistry - Binospirone

* No ChemSpiderID

* PubChem: 60769

* No InChI

* No SMILES
Biolimus_A9 (2033)
```
Botcommand: addindex 351098640 Biolimus_A9
```
```
For index : Biolimus_A9=351098640
```
* 851536-75-9 -> 851536-75-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Biolimus A not found on commonchemistry - Biolimus A

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Biopterin (2034)
```
Botcommand: addindex 360050348 Biopterin
```
```
For index : Biopterin=360050348
```
* 22150-76-1 -> 22150-76-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Biopterin not found on commonchemistry - Biopterin

* ChemSpiderID: 2288 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 2380

* InChI: 1/C9H11N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h2-3,6,15-16H,1H3,(H3,10,11,13,14,17) - (ChemSpider: | InChI=InChI=1/C9H11N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h2-3,6,15-16H,1H3,(H3,10,11,13,14,17) )

* SMILES: O=C2\N=C(/Nc1ncc(nc12)C(O)C(O)C)N - (ChemSpider: | SMILES=O=C2\N=C(/Nc1ncc(nc12)C(O)C(O)C)N )
Biphenylene (2038)
```
Botcommand: addindex 319495409 Biphenylene
```
```
For index : Biphenylene=319495409
```
* 259-79-0 -> 259-79-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Biphenylene found on commonchemistry - Biphenylene
* 86-73-7 (Formula: C13H10; Name: 9H-Fluorene)

* 132-64-9 (Formula: C12H8O; Name: Dibenzofuran)

* 298-83-9 (Formula: C40H30N10O6.2Cl; Name: 2H-Tetrazolium, 2,2'-(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis[3-(4-nitrophenyl)-5-phenyl-, dichloride)

* 29319-22-0 (Formula: (C16H6O6.C6H8N2)x; Name: [5,5'-Biisobenzofuran]-1,1',3,3'-tetrone, polymer with 1,4-benzenediamine)

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Biphenylindanone_A (2039)

* No CASNo

* Biphenylindanone A not found on commonchemistry - Biphenylindanone A

* No ChemSpiderID

* PubChem: 9868580

* No InChI

* No SMILES
Bis(2,4,5-trichlorophenyl-6-carbopentoxyphenyl)oxalate (2041)
```
Botcommand: addindex 332829232 Bis(2,4,5-trichlorophenyl-6-carbopentoxyphenyl)oxalate
```
```
For index : Bis(2,4,5-trichlorophenyl-6-carbopentoxyphenyl)oxalate=332829232
```
* 30431-54-0 -> 30431-54-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Bis trichlorophenyl carbopentoxyphenyl oxalate not found on commonchemistry - Bis trichlorophenyl carbopentoxyphenyl oxalate

* ChemSpiderID: 84082 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 93137

* InChI: 1/C26H24Cl6O8/c1-3-5-7-9-37-23(33)17-19(31)13(27)11-15(29)21(17)39-25(35)26(36)40-22-16(30)12-14(28)20(32)18(22)24(34)38-10-8-6-4-2/h11-12H,3-10H2,1-2H3 - (ChemSpider: | InChI=InChI=1/C26H24Cl6O8/c1-3-5-7-9-37-23(33)17-19(31)13(27)11-15(29)21(17)39-25(35)26(36)40-22-16(30)12-14(28)20(32)18(22)24(34)38-10-8-6-4-2/h11-12H,3-10H2,1-2H3 )

* SMILES: Clc2c(C(=O)OCCCCC)c(OC(=O)C(=O)Oc1c(C(=O)OCCCCC)c(Cl)c(Cl)cc1Cl)c(Cl)cc2Cl - (ChemSpider: | SMILES=Clc2c(C(=O)OCCCCC)c(OC(=O)C(=O)Oc1c(C(=O)OCCCCC)c(Cl)c(Cl)cc1Cl)c(Cl)cc2Cl )
Bis(2,4-dinitrophenyl)_oxalate (2042)
```
Botcommand: addindex 342929199 Bis(2,4-dinitrophenyl)_oxalate
```
```
For index : Bis(2,4-dinitrophenyl)_oxalate=342929199
```
* 16536-30-4 -> 16536-30-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Bis dinitrophenyl oxalate not found on commonchemistry - Bis dinitrophenyl oxalate

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O=C(Oc1ccc(cc1[N ]([O-])=O)[N ]([O-])=O)C(=O)Oc2ccc([N ]([O-])=O)cc2[N ]([O-])=O
Bis(2-chloroethyl)ethylamine (2043)
```
Botcommand: addindex 337180678 Bis(2-chloroethyl)ethylamine
```
```
For index : Bis(2-chloroethyl)ethylamine=337180678
```
* 538-07-8 -> 538-07-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Bis chloroethyl ethylamine not found on commonchemistry - Bis chloroethyl ethylamine

* ChemSpiderID: 10391 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 10848

* InChI: 1/C6H13Cl2N/c1-2-9(5-3-7)6-4-8/h2-6H2,1H3 - (ChemSpider: | InChI=InChI=1/C6H13Cl2N/c1-2-9(5-3-7)6-4-8/h2-6H2,1H3 )

* SMILES: ClCCN(CC)CCCl - (ChemSpider: | SMILES=ClCCN(CC)CCCl )
Bis(benzene)chromium (2046)
```
Botcommand: addindex 356437630 Bis(benzene)chromium
```
```
For index : Bis(benzene)chromium=356437630
```
* 1271-54-1 -> 1271-54-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Bis benzene chromium not found on commonchemistry - Bis benzene chromium

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Bis(chloromethyl)_ether (2047)
```
Botcommand: addindex 361428869 Bis(chloromethyl)_ether
```
```
For index : Bis(chloromethyl)_ether=361428869
```
* 542-88-1 -> 542-88-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Bis chloromethyl ether not found on commonchemistry - Bis chloromethyl ether

* ChemSpiderID: 21106500 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 10967

* InChI: 1/C2H4Cl2O/c3-1-5-2-4/h1-2H2 - (ChemSpider: | InChI=InChI=1/C2H4Cl2O/c3-1-5-2-4/h1-2H2 )

* SMILES: ClCOCCl - (ChemSpider: | SMILES=ClCOCCl )
Bis(pinacolato)diboron (2049)
```
Botcommand: addindex 361849246 Bis(pinacolato)diboron
```
```
For index : Bis(pinacolato)diboron=361849246
```
* 73183-34-3 -> 73183-34-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Bis pinacolato diboron not found on commonchemistry - Bis pinacolato diboron

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Bis(trimethylsilyl)acetamide (2050)
```
Botcommand: addindex 361849235 Bis(trimethylsilyl)acetamide
```
```
For index : Bis(trimethylsilyl)acetamide=361849235
```
* 10416-59-8 -> 10416-59-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Bis trimethylsilyl acetamide not found on commonchemistry - Bis trimethylsilyl acetamide

* No ChemSpiderID

* PubChem: 6913588

* InChI: InChI=1/C8H21NOSi2/c1-8(9-11(2,3)4)10-12(5,6)7/h1-7H3/b9-8

* SMILES: CC(=N[Si](C)(C)C)O[Si](C)(C)C

2051 to 2100

Bis(trimethylsilyl)mercury (2052)

* No CASNo

* Bis trimethylsilyl mercury not found on commonchemistry - Bis trimethylsilyl mercury

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Bis(trimethylsilyl)sulfide (2053)
```
Botcommand: addindex 337613378 Bis(trimethylsilyl)sulfide
```
```
For index : Bis(trimethylsilyl)sulfide=337613378
```
* 3385-94-2 -> 3385-94-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Bis trimethylsilyl sulfide not found on commonchemistry - Bis trimethylsilyl sulfide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Bis(triphenylphosphine)iminium_chloride (2054)
```
Botcommand: addindex 345270468 Bis(triphenylphosphine)iminium_chloride
```
```
For index : Bis(triphenylphosphine)iminium_chloride=345270468
```
* 21050-13-5 -> 21050-13-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Bis triphenylphosphine iminium chloride not found on commonchemistry - Bis triphenylphosphine iminium chloride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Bis-HPPP (2056)
```
Botcommand: addindex 364300436 Bis-HPPP
```
```
For index : Bis-HPPP=364300436
```
* 116-37-0 -> 116-37-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Bis HPPP not found on commonchemistry - Bis HPPP

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: OCC(O)COc1ccc(cc1)C(C)(C)c2ccc(OCC(O)CO)cc2
Bis-tris_methane (2058)
File:Bis-tris methane-Line-Structure.svg
```
Botcommand: addindex 359302247 Bis-tris_methane
```
```
For index : Bis-tris_methane=359302247
```
* 6976-37-0 -> 6976-37-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Bis tris methane not found on commonchemistry - Bis tris methane

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: OCC(CO)(N(CCO)CCO)CO
Bis-tris_propane (2059)
```
Botcommand: addindex 316165845 Bis-tris_propane
```
```
For index : Bis-tris_propane=316165845
```
* 64431-96-5 -> 64431-96-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Bis tris propane not found on commonchemistry - Bis tris propane

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: OCC(CO)(CO)NCCCNC(CO)(CO)CO
Bisabolol (2060)
```
Botcommand: addindex 354907494 Bisabolol
```
```
For index : Bisabolol=354907494
```
* 23089-26-1 -> 23089-26-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Bisabolol found on commonchemistry - Bisabolol
* 515-69-5 (exact match)
Name in list

All names: [[(. -.)-Î±-bisabolol]], (R*,R*)-Î±,4-Dimethyl-Î±-(4-methyl-3-pentenyl)-3-cyclohexene-1-methanol, (R*,R*)-Î±,4-Dimethyl-Î±-(4-methyl-3-pentenyl)cyclohex-3-en-1-methanol, (R*,R*)-Î±,4-dimethyl-Î±-(4-methyl-3-pentenyl)cyclohex-3-ene-1-methanol, (R*,R*)-Î±,4-Dimethyl-Î±-(4-methyl-3-pentenyl)cyclohex-3-ene-1-methanol, (R*,R*)-Î±,4-dimetil-Î±-(4-metil-3-pentenil)ciclohex-3-eno-1-metanol, 3-Cyclohexene-1-methanol, Î±,4-dimethyl-Î±-(4-methyl-3-penten-1-yl)-, (Î±R,1R)-rel-, 3-Cyclohexene-1-methanol, Î±,4-dimethyl-Î±-(4-methyl-3-pentenyl)-, (R*,R*)-, 3-Cyclohexene-1-methanol, Î±,4-dimethyl-Î±-(4-methyl-3-pentenyl)-, (Î±R,1R)-rel-, 5-Hepten-2-ol, 6-methyl-2-(4-methyl-3-cyclohexen-1-yl)-, 6-Methyl-2-(4-methyl-3-cyclohexen-1-yl)-5-hepten-2-ol, [[bisabolol]], Camilol, CYCLOHEX-3-ENE, 1-(HYDROXYMETHYL)-Î±,4-DIMETHYL-Î±-(4-METHYL-3-PENTENYL)-,(R*,R*)-(. -.)-, CYCLOHEX-3-ENE, Î±-4-DIMETHYL-Î±-(4-METHYL-3-PENTENYL)-1-(HYDROXYMETHYL)-, (R*,R*)-, [[dl-Î±-bisabolol]], DRAGOSANTOL, Hydagen B, [[Î±-bisabolol]]

* ChemSpiderID: 390796 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/C15H26O/c1-12(2)6-5-11-15(4,16)14-9-7-13(3)8-10-14/h6-7,14,16H,5,8-11H2,1-4H3/t14-,15 /m1/s1 - (ChemSpider: | InChI=InChI=1/C15H26O/c1-12(2)6-5-11-15(4,16)14-9-7-13(3)8-10-14/h6-7,14,16H,5,8-11H2,1-4H3/t14-,15 /m1/s1 )

* SMILES: O[C@@](C)(CC\C=C(/C)C)[C@@H]1C/C=C(/C)CC1 - (ChemSpider: | SMILES=O[C@@](C)(CC\C=C(/C)C)[C@@H]1C/C=C(/C)CC1 )
Bisdisulizole_disodium (2062)
```
Botcommand: addindex 332772587 Bisdisulizole_disodium
```
```
For index : Bisdisulizole_disodium=332772587
```
* 180898-37-7 -> 180898-37-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Bisdisulizole disodium not found on commonchemistry - Bisdisulizole disodium

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Bismarck_brown_Y (2063)
```
Botcommand: addindex 303839547 Bismarck_brown_Y
```
```
For index : Bismarck_brown_Y=303839547
```
* 8005-77-4 -> 8005-77-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Bismarck brown Y not found on commonchemistry - Bismarck brown Y

* No ChemSpiderID

* PubChem: 24674

* No InChI

* SMILES: CC1=C(C=C(C=C1)N=NC2=C(C=C(C(=C2)C)N)N)N=NC3=C(C=C(C(=C3)C)N)N
Bismole (2064)
```
Botcommand: addindex 355662645 Bismole
```
```
For index : Bismole=355662645
```
* 89067-15-2 -> 89067-15-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Bismole not found on commonchemistry - Bismole

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: C1=CC=CBi1
Bismuth_oxychloride (2066)
```
Botcommand: addindex 361386124 Bismuth_oxychloride
```
```
For index : Bismuth_oxychloride=361386124
```
* 7787-59-9 -> 7787-59-9 - NOT VERIFIED

* CAS found on commonchemistry - 7787-59-9 - name in list
All names: Basic bismuth chloride, Bi-Flair 66a, Bi-Flair 84, Biju, Biron, Biron B 50, Biron ESQ, Biron Fines, Biron LF 2000, Biron Liquid Silver, Biron MTU, Biron Silver CO, Bi-Run, Bismutchloridoxid, BISMUTH (III) OXYCHLORIDE, Bismuth chloride (BiOCl), bismuth chloride oxide, Bismuth chloride oxide (BiClO), Bismuth chloride oxide (BiOCl), Bismuth monochloride monoxide, Bismuth oxide chloride (BiOCl), Bismuth oxychloride, Bismuth oxychloride (BiOCl), Bismuth subchloride, Bismuthine, chlorooxo-, Bismuthyl chloride, Bital, Blanc de Perle, Blanc d'Espagne, C.I. 77163, C.I. Pigment White 14, C.I. Pigment White 31, Chlorbismol, Chlorooxobismuth, Chlorooxobismuthine, Chromalite Black, Cosmetic Bismuth, Flake White, Mearlite, Mearlite GBU, Mearlite LBU, Mearlite Pearlescent EP 91143, Mearlite Radiant Pearl SUQ, Mearlite Ultrabright USD, Mearlite UltraFine OFS, Nailsyn Sterling 60, oxicloruro de bismuto, Oxychlorure de bismuth, Pearl Powder Mixture FCT 1251D, Pearl Powder Mixture FCT 125A, Pearl Powder Mixture FCT 138A, Pearl White, Pearl-Glo, Pearl-Glo CO, Pearl-Glo MO, Pearl-Glo UVR, Pigment White 14, PL 6-53D, Rona Biron Silver, Spanish White, STL, UFI, WISMUT(III)-CHLORID-OXID

* Bismuth oxychloride found on commonchemistry - Bismuth oxychloride
* 7787-59-9 (exact match) Matches CAS (7787-59-9) on page
Name in list

All names: Basic bismuth chloride, Bi-Flair 66a, Bi-Flair 84, Biju, Biron, Biron B 50, Biron ESQ, Biron Fines, Biron LF 2000, Biron Liquid Silver, Biron MTU, Biron Silver CO, Bi-Run, Bismutchloridoxid, BISMUTH (III) OXYCHLORIDE, Bismuth chloride (BiOCl), bismuth chloride oxide, Bismuth chloride oxide (BiClO), Bismuth chloride oxide (BiOCl), Bismuth monochloride monoxide, Bismuth oxide chloride (BiOCl), [[bismuth oxychloride]], [[bismuth oxychloride (BiOCl)]], Bismuth subchloride, Bismuthine, chlorooxo-, Bismuthyl chloride, Bital, Blanc de Perle, Blanc d'Espagne, C.I. 77163, C.I. Pigment White 14, C.I. Pigment White 31, Chlorbismol, Chlorooxobismuth, Chlorooxobismuthine, Chromalite Black, Cosmetic Bismuth, Flake White, Mearlite, Mearlite GBU, Mearlite LBU, Mearlite Pearlescent EP 91143, Mearlite Radiant Pearl SUQ, Mearlite Ultrabright USD, Mearlite UltraFine OFS, Nailsyn Sterling 60, oxicloruro de bismuto, Oxychlorure de bismuth, Pearl Powder Mixture FCT 1251D, Pearl Powder Mixture FCT 125A, Pearl Powder Mixture FCT 138A, Pearl White, Pearl-Glo, Pearl-Glo CO, Pearl-Glo MO, Pearl-Glo UVR, Pigment White 14, PL 6-53D, Rona Biron Silver, Spanish White, STL, UFI, WISMUT(III)-CHLORID-OXID

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Bismuth_pentafluoride (2067)
```
Botcommand: addindex 361693975 Bismuth_pentafluoride
```
```
For index : Bismuth_pentafluoride=361693975
```
* 7787-62-4 -> 7787-62-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Bismuth pentafluoride not found on commonchemistry - Bismuth pentafluoride

* ChemSpiderID: 21172752 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/Bi.5FH.3H/h;5*1H;;;/q 3;;;;;;;;/p-5/rBiH3.5FH/h1H3;5*1H/q 3;;;;;/p-5 - (ChemSpider: | InChI=InChI=1/Bi.5FH.3H/h;5*1H;;;/q 3;;;;;;;;/p-5/rBiH3.5FH/h1H3;5*1H/q 3;;;;;/p-5 )

* SMILES: [F-].[F-].[F-].[F-].[F-].[BiH3 3] - (ChemSpider: | SMILES=[F-].[F-].[F-].[F-].[F-].[BiH3 3] )
Bismuth_subcarbonate (2068)
```
Botcommand: addindex 361387246 Bismuth_subcarbonate
```
```
For index : Bismuth_subcarbonate=361387246
```
* 5892-10-4 -> 5892-10-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Bismuth subcarbonate not found on commonchemistry - Bismuth subcarbonate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Bismuth_tribromide (2072)
File:Bromid bismutitÃ½.PNG
```
Botcommand: addindex 361385072 Bismuth_tribromide
```
```
For index : Bismuth_tribromide=361385072
```
* 7787-58-8 -> 7787-58-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Bismuth tribromide not found on commonchemistry - Bismuth tribromide

* ChemSpiderID: 74210 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 24884077

* InChI: 1/Bi.3BrH/h;3*1H/q 3;;;/p-3 - (ChemSpider: | InChI=InChI=1/Bi.3BrH/h;3*1H/q 3;;;/p-3 )

* SMILES: Br[Bi](Br)Br - (ChemSpider: | SMILES=Br[Bi](Br)Br )
Bismuth_trifluoride (2073)
```
Botcommand: addindex 332834564 Bismuth_trifluoride
```
```
For index : Bismuth_trifluoride=332834564
```
* 7787-61-3 -> 7787-61-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Bismuth trifluoride not found on commonchemistry - Bismuth trifluoride

* ChemSpiderID: 21172751 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/Bi.3FH.3H/h;3*1H;;;/q 3;;;;;;/p-3/rBiH3.3FH/h1H3;3*1H/q 3;;;/p-3 - (ChemSpider: | InChI=InChI=1/Bi.3FH.3H/h;3*1H;;;/q 3;;;;;;/p-3/rBiH3.3FH/h1H3;3*1H/q 3;;;/p-3 )

* SMILES: [F-].[F-].[F-].[BiH3 3] - (ChemSpider: | SMILES=[F-].[F-].[F-].[BiH3 3] )
Bismuth(III)_iodide (2074)
```
Botcommand: addindex 361508346 Bismuth(III)_iodide
```
```
For index : Bismuth(III)_iodide=361508346
```
* 7787-64-6 -> 7787-64-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Bismuth III iodide not found on commonchemistry - Bismuth III iodide

* ChemSpiderID: 21172753 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 24860889

* InChI: 1/Bi.3HI.3H/h;3*1H;;;/q 3;;;;;;/p-3/rBiH3.3HI/h1H3;3*1H/q 3;;;/p-3 - (ChemSpider: | InChI=InChI=1/Bi.3HI.3H/h;3*1H;;;/q 3;;;;;;/p-3/rBiH3.3HI/h1H3;3*1H/q 3;;;/p-3 )

* SMILES: [I-].[I-].[I-].[BiH3 3] - (ChemSpider: | SMILES=[I-].[I-].[I-].[BiH3 3] )
Bismuthine (2077)
```
Botcommand: addindex 354245406 Bismuthine
```
```
For index : Bismuthine=354245406
```
* 18288-22-7 -> 18288-22-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Bismuthine found on commonchemistry - Bismuthine
* 603-33-8 (Formula: C18H15Bi; Name: Bismuthine, triphenyl-)

* 7787-59-9 (Formula: BiClO; Name: Bismuthine, chlorooxo-)

* 7787-60-2 (Formula: BiCl3; Name: Bismuthine, trichloro-)

* No ChemSpiderID

* PubChem: 9242

* No InChI

* No SMILES
Bisoxatin (2080)

* No CASNo

* Bisoxatin not found on commonchemistry - Bisoxatin

* No ChemSpiderID

* PubChem: 28689

* No InChI

* No SMILES
Bisphenol_A_diglycidyl_ether (2082)

* No CASNo

* Bisphenol A diglycidyl ether found on commonchemistry - Bisphenol A diglycidyl ether
* 1675-54-3 (Formula: C21H24O4; Name: Oxirane, 2,2'-[(1-methylethylidene)bis(4,1-phenyleneoxymethylene)]bis-)

* 1565-94-2 (Formula: C29H36O8; Name: 2-Propenoic acid, 2-methyl-, (1-methylethylidene)bis[4,1-phenyleneoxy(2-hydroxy-3,1-propanediyl)] ester)

* 25085-99-8 (Formula: (C21H24O4)x; Name: Oxirane, 2,2'-[(1-methylethylidene)bis(4,1-phenyleneoxymethylene)]bis-, homopolymer)

* 33294-14-3 (Formula: (C21H20Br4O4)x; Name: Oxirane, 2,2'-[(1-methylethylidene)bis[(2,6-dibromo-4,1-phenylene)oxymethylene]]bis-, homopolymer)

* 66070-75-5 (Formula: (C15H16O2.C3H5ClO.Unspecified)x; Name: Fatty acids, tall-oil, polymers with bisphenol A and epichlorohydrin)

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Bissulfosuccinimidyl_suberate (2084)
```
Botcommand: addindex 352890522 Bissulfosuccinimidyl_suberate
```
```
For index : Bissulfosuccinimidyl_suberate=352890522
```
* 82436-77-9 -> 82436-77-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Bissulfosuccinimidyl suberate not found on commonchemistry - Bissulfosuccinimidyl suberate

* No ChemSpiderID

* PubChem: 123854

* No InChI

* SMILES: C1C(C(=O)N(C1=O)OC(=O)CCCCCCC(=O)ON2C(=O)CC(C2=O)S(=O)(=O)O)S(=O)(=O)O
Bisulepine (2085)
```
Botcommand: addindex 347451219 Bisulepine
```
```
For index : Bisulepine=347451219
```
* 5802-61-9 -> 5802-61-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Bisulepine not found on commonchemistry - Bisulepine

* ChemSpiderID: 64022 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 6436111

* No InChI - (ChemSpider: | InChI=InChI=1/C17H19NS2/c1-18(2)10-5-8-15-14-7-4-3-6-13(14)12-20-17-16(15)9-11-19-17/h3-4,6-9,11H,5,10,12H2,1-2H3 )

* No SMILES - (ChemSpider: | smiles=s1ccc2c1SCc3c(C2=CCCN(C)C)cccc3 )
Bithionol (2086)
```
Botcommand: addindex 343219860 Bithionol
```
```
For index : Bithionol=343219860
```
* 97-18-7 -> 97-18-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Bithionol not found on commonchemistry - Bithionol

* No ChemSpiderID

* PubChem: 2406

* No InChI

* No SMILES
Bitolterol (2087)
```
Botcommand: addindex 346367253 Bitolterol
```
```
For index : Bitolterol=346367253
```
* 30392-41-7 -> 30392-41-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Bitolterol not found on commonchemistry - Bitolterol

* ChemSpiderID: 32525 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 35330

* No InChI - (ChemSpider: | InChI=InChI=1/C28H31NO5/c1-18-6-10-20(11-7-18)26(31)33-24-15-14-22(23(30)17-29-28(3,4)5)16-25(24)34-27(32)21-12-8-19(2)9-13-21/h6-16,23,29-30H,17H2,1-5H3 )

* No SMILES - (ChemSpider: | smiles=O=C(Oc2cc(ccc2OC(=O)c1ccc(cc1)C)C(O)CNC(C)(C)C)c3ccc(cc3)C )
Bivatuzumab_mertansine (2090)
* No CASNo

* Bivatuzumab mertansine not found on commonchemistry - Bivatuzumab mertansine

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Bixin (2091)
```
Botcommand: addindex 354775552 Bixin
```
```
For index : Bixin=354775552
```
* 6983-79-5 -> 6983-79-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Bixin not found on commonchemistry - Bixin

* ChemSpiderID: 4444638 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 5281226

* InChI: 1/C25H30O4/c1-20(12-8-14-22(3)16-18-24(26)27)10-6-7-11-21(2)13-9-15-23(4)17-19-25(28)29-5/h6-19H,1-5H3,(H,26,27)/b7-6 ,12-8 ,13-9 ,18-16 ,19-17 ,20-10 ,21-11 ,22-14 ,23-15- - (ChemSpider: | InChI=InChI=1/C25H30O4/c1-20(12-8-14-22(3)16-18-24(26)27)10-6-7-11-21(2)13-9-15-23(4)17-19-25(28)29-5/h6-19H,1-5H3,(H,26,27)/b7-6 ,12-8 ,13-9 ,18-16 ,19-17 ,20-10 ,21-11 ,22-14 ,23-15- )

* SMILES: O=C(O)\C=C\C(=C\C=C\C(=C\C=C\C=C(\C=C\C=C(/C=C/C(=O)OC)C)C)C)C - (ChemSpider: | SMILES=O=C(O)\C=C\C(=C\C=C\C(=C\C=C\C=C(\C=C\C=C(/C=C/C(=O)OC)C)C)C)C )
Black_7984 (2092)

* No CASNo

* Black found on commonchemistry - Black
* 101-54-2 (Formula: C12H12N2; Name: 1,4-Benzenediamine, N-phenyl-)

* 106-50-3 (Formula: C6H8N2; Name: 1,4-Benzenediamine)

* 119-90-4 (Formula: C14H16N2O2; Name: [1,1'-Biphenyl]-4,4'-diamine, 3,3'-dimethoxy-)

* 123-31-9 (Formula: C6H6O2; Name: 1,4-Benzenediol)

* 409-21-2 (Formula: CSi; Name: Silicon carbide, (SiC))

* 1302-78-9 (Formula: Unspecified; Name: Bentonite)

* 1307-96-6 (Formula: CoO; Name: Cobalt oxide, (CoO))

* 1309-38-2 (Formula: Fe.O; Name: Magnetite, (Fe3O4))

* 1314-98-3 (Formula: SZn; Name: Zinc sulfide, (ZnS))

* 1317-33-5 (Formula: MoS2; Name: Molybdenum sulfide, (MoS2))

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Blasticidin_S (2093)

* No CASNo

* Blasticidin S not found on commonchemistry - Blasticidin S

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Blattellaquinone (2094)
```
Botcommand: addindex 355562394 Blattellaquinone
```
```
For index : Blattellaquinone=355562394
```
* 849762-24-9 -> 849762-24-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Blattellaquinone not found on commonchemistry - Blattellaquinone

* ChemSpiderID: 9553964 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/C12H14O4/c1-8(2)5-12(15)16-7-9-6-10(13)3-4-11(9)14/h3-4,6,8H,5,7H2,1-2H3 - (ChemSpider: | InChI=InChI=1/C12H14O4/c1-8(2)5-12(15)16-7-9-6-10(13)3-4-11(9)14/h3-4,6,8H,5,7H2,1-2H3 )

* SMILES: O=C/1/C=C\C(=O)\C=C\1COC(=O)CC(C)C - (ChemSpider: | SMILES=O=C/1/C=C\C(=O)\C=C\1COC(=O)CC(C)C )
Blinatumomab (2096)
```
Botcommand: addindex 348630900 Blinatumomab
```
```
For index : Blinatumomab=348630900
```
* 853426-35-4 -> 853426-35-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Blinatumomab not found on commonchemistry - Blinatumomab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Blonanserin (2097)
```
Botcommand: addindex 349701137 Blonanserin
```
```
For index : Blonanserin=349701137
```
* 132810-10-7 -> 132810-10-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Blonanserin not found on commonchemistry - Blonanserin

* ChemSpiderID: 111697 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 125564

* No InChI - (ChemSpider: | InChI=InChI=1/C23H30FN3/c1-2-26-13-15-27(16-14-26)23-17-21(18-9-11-19(24)12-10-18)20-7-5-3-4-6-8-22(20)25-23/h9-12,17H,2-8,13-16H2,1H3 )

* No SMILES - (ChemSpider: | smiles=Fc1ccc(cc1)c2cc(nc3c2CCCCCC3)N4CCN(CC)CC4 )
Boceprevir (2098)
```
Botcommand: addindex 362095935 Boceprevir
```
```
For index : Boceprevir=362095935
```
* 394730-60-0 -> 394730-60-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Boceprevir not found on commonchemistry - Boceprevir

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Bolasterone (2099)
```
Botcommand: addindex 341075706 Bolasterone
```
```
For index : Bolasterone=341075706
```
* 1605-89-6 -> 1605-89-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Bolasterone not found on commonchemistry - Bolasterone

* ChemSpiderID: 92280 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 102146

* InChI: 1/C21H32O2/c1-13-11-14-12-15(22)5-8-19(14,2)16-6-9-20(3)17(18(13)16)7-10-21(20,4)23/h12-13,16-18,23H,5-11H2,1-4H3/t13-,16 ,17 ,18-,19 ,20 ,21 /m1/s1 - (ChemSpider: | InChI=InChI=1/C21H32O2/c1-13-11-14-12-15(22)5-8-19(14,2)16-6-9-20(3)17(18(13)16)7-10-21(20,4)23/h12-13,16-18,23H,5-11H2,1-4H3/t13-,16 ,17 ,18-,19 ,20 ,21 /m1/s1 )

* SMILES: O=C4\C=C3/[C@]([C@H]2CC[C@]1([C@@H](CC[C@@]1(O)C)[C@@H]2[C@H](C)C3)C)(C)CC4 - (ChemSpider: | SMILES=O=C4\C=C3/[C@]([C@H]2CC[C@]1([C@@H](CC[C@@]1(O)C)[C@@H]2[C@H](C)C3)C)(C)CC4 )
Bolazine (2100)
```
Botcommand: addindex 356724384 Bolazine
```
```
For index : Bolazine=356724384
```
* 4267-81-6 -> 4267-81-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Bolazine not found on commonchemistry - Bolazine

* No ChemSpiderID

* PubChem: 9578205

* No InChI

* SMILES: C[C@@]23[C@](CC[C@]4([H])[C@@]([H])3CC[C@@]5(C)[C@]([H])4CC[C@@H]5O)([H])C/C([C@H](C)C2)=N/N=C1[C@H](C)C[C@@]6(C)[C@](CC[C@]7([H])[C@@]([H])6CC[C@@]8(C)[C@]([H])7CC[C@@H]8O)([H])C/1

2101 to 2150

Boldine (2102)
```
Botcommand: addindex 355665999 Boldine
```
```
For index : Boldine=355665999
```
* 476-70-0 -> 476-70-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Boldine not found on commonchemistry - Boldine

* No ChemSpiderID

* PubChem: 10154

* No InChI

* SMILES: CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=CC(=C(C=C43)OC)O)OC)O
Boldione (2103)
```
Botcommand: addindex 360371893 Boldione
```
```
For index : Boldione=360371893
```
* 897-06-3 -> 897-06-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Boldione not found on commonchemistry - Boldione

* ChemSpiderID: 12893 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 13472

* InChI: 1/C19H24O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h7,9,11,14-16H,3-6,8,10H2,1-2H3/t14-,15-,16-,18-,19-/m0/s1 - (ChemSpider: | InChI=InChI=1/C19H24O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h7,9,11,14-16H,3-6,8,10H2,1-2H3/t14-,15-,16-,18-,19-/m0/s1 )

* SMILES: O=C\1\C=C/[C@]3(/C(=C/1)CC[C@H]4[C@@H]2CCC(=O)[C@]2(CC[C@H]34)C)C - (ChemSpider: | SMILES=O=C\1\C=C/[C@]3(/C(=C/1)CC[C@H]4[C@@H]2CCC(=O)[C@]2(CC[C@H]34)C)C )
Bolenol (2104)
```
Botcommand: addindex 356724458 Bolenol
```
```
For index : Bolenol=356724458
```
* 16915-78-9 -> 16915-78-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Bolenol not found on commonchemistry - Bolenol

* No ChemSpiderID

* PubChem: 11954311

* No InChI

* SMILES: CC[C@@]1(CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@H]3CCCC4)C)O
Bombesin (2105)
```
Botcommand: addindex 360225343 Bombesin
```
```
For index : Bombesin=360225343
```
* 31362-50-2 -> 31362-50-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Bombesin not found on commonchemistry - Bombesin

* No ChemSpiderID

* PubChem: 16133891

* No InChI

* No SMILES
Bombykol (2106)
```
Botcommand: addindex 354907771 Bombykol
```
```
For index : Bombykol=354907771
```
* 765-17-3 -> 765-17-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Bombykol not found on commonchemistry - Bombykol

* No ChemSpiderID

* PubChem: 445128

* No InChI

* SMILES: CCC/C=C\C=C\CCCCCCCCCO
Bongkrek_acid (2107)
```
Botcommand: addindex 281271407 Bongkrek_acid
```
```
For index : Bongkrek_acid=281271407
```
* 11076-19-0 -> 11076-19-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Bongkrek acid not found on commonchemistry - Bongkrek acid

* No ChemSpiderID

* PubChem: 6433556

* No InChI

* SMILES: O=C(O)C(\C)=C\C=C(\C)[C@@H](C/C=C\C=C\CC\C=C\C[C@H](C)/C=C/C(=C\C(=O)O)/CC(=O)O)OC
Bopindolol (2108)
```
Botcommand: addindex 351661399 Bopindolol
```
```
For index : Bopindolol=351661399
```
* 69010-88-4 -> 69010-88-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Bopindolol not found on commonchemistry - Bopindolol

* No ChemSpiderID

* PubChem: 44112

* No InChI

* No SMILES
Borax (2109)
```
Botcommand: addindex 364215508 Borax
```
```
For index : Borax=364215508
```
* 1303-96-4 (decahydrate) -> (decahydrate) 1303-96-4 (decahydrate) - NOT VERIFIED

* The CAS number '1303-96-4 (decahydrate)' is not formatted correctly, please repair the contents of the field CASNo or CAS_number

* Borax found on commonchemistry - Borax
* 1303-96-4 (Formula: B4Na2O7.10H2O; Name: Borax, (B4Na2O7.10H2O))

* 1330-43-4 (Formula: B4Na2O7; Name: Boron sodium oxide, (B4Na2O7))

* 7782-42-5 (Formula: C; Name: Graphite)

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Borazine (2110)
```
Botcommand: addindex 361919430 Borazine
```
```
For index : Borazine=361919430
```
* 6569-51-3 -> 6569-51-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Borazine not found on commonchemistry - Borazine

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: B1NBNBN1
Borirane (2112)
```
Botcommand: addindex 360912068 Borirane
```
```
For index : Borirane=360912068
```
* 39517-80-1 -> 39517-80-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Borirane not found on commonchemistry - Borirane

* No ChemSpiderID

* No PubChem

* InChI: 1/C2H5B/c1-2-3-1/h3H,1-2H2

* SMILES: B1CC1
Bornane (2113)

* No CASNo

* Bornane found on commonchemistry - Bornane
* 60-40-2 (Formula: C11H21N; Name: Bicyclo[2.2.1]heptan-2-amine, N,2,3,3-tetramethyl-)

* 76-22-2 (Formula: C10H16O; Name: Bicyclo[2.2.1]heptan-2-one, 1,7,7-trimethyl-)

* 79-92-5 (Formula: C10H16; Name: Bicyclo[2.2.1]heptane, 2,2-dimethyl-3-methylene-)

* 124-76-5 (Formula: C10H18O; Name: Bicyclo[2.2.1]heptan-2-ol, 1,7,7-trimethyl-, (1R,2R,4R)-rel-)

* 464-49-3 (Formula: C10H16O; Name: Bicyclo[2.2.1]heptan-2-one, 1,7,7-trimethyl-, (1R,4R)-)

* 497-38-1 (Formula: C7H10O; Name: Bicyclo[2.2.1]heptan-2-one)

* 507-70-0 (Formula: C10H18O; Name: Bicyclo[2.2.1]heptan-2-ol, 1,7,7-trimethyl-, (1R,2S,4R)-rel-)

* 1195-79-5 (Formula: C10H16O; Name: Bicyclo[2.2.1]heptan-2-one, 1,3,3-trimethyl-)

* 1209-98-9 (Formula: C15H21N; Name: Bicyclo[2.2.1]heptan-2-amine, N-ethyl-3-phenyl-)

* 3144-16-9 (Formula: C10H16O4S; Name: Bicyclo[2.2.1]heptane-1-methanesulfonic acid, 7,7-dimethyl-2-oxo-, (1S,4R)-)

* No ChemSpiderID

* PubChem: 92108

* No InChI

* SMILES: CC1(C2CCC1(CC2)C)C
Bornaprine (2114)
```
Botcommand: addindex 349572894 Bornaprine
```
```
For index : Bornaprine=349572894
```
* 20448-86-6 -> 20448-86-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Bornaprine not found on commonchemistry - Bornaprine

* ChemSpiderID: 28011 (correct: 28011) - CORRECT - Retrieved data from ChemSpider

* PubChem: 30160

* No InChI - (ChemSpider: | InChI=InChI=1/C21H31NO2/c1-3-22(4-2)13-8-14-24-20(23)21(18-9-6-5-7-10-18)16-17-11-12-19(21)15-17/h5-7,9-10,17,19H,3-4,8,11-16H2,1-2H3 )

* No SMILES - (ChemSpider: | smiles=O=C(OCCCN(CC)CC)C2(c1ccccc1)CC3CCC2C3 )
Borole (2116)
```
Botcommand: addindex 355667149 Borole
```
```
For index : Borole=355667149
```
* 287-87-6 -> 287-87-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Borole not found on commonchemistry - Borole

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: C1=CC=CB1
Boron_arsenide (2118)
```
Botcommand: addindex 283199460 Boron_arsenide
```
```
For index : Boron_arsenide=283199460
```
* 12005-69-5 -> 12005-69-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Boron arsenide not found on commonchemistry - Boron arsenide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Boron_monoxide (2120)
```
Botcommand: addindex 324630771 Boron_monoxide
```
```
For index : Boron_monoxide=324630771
```
* 12045-60-2 -> 12045-60-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Boron monoxide not found on commonchemistry - Boron monoxide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Boron_phosphide (2122)
```
Botcommand: addindex 361136821 Boron_phosphide
```
```
For index : Boron_phosphide=361136821
```
* 20205-91-8 -> 20205-91-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Boron phosphide not found on commonchemistry - Boron phosphide

* No ChemSpiderID

* PubChem: 88409

* No InChI

* No SMILES
Boron_suboxide (2123)

* No CASNo

* Boron suboxide not found on commonchemistry - Boron suboxide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Boron_sulfide (2124)
```
Botcommand: addindex 346860736 Boron_sulfide
```
```
For index : Boron_sulfide=346860736
```
* 12007-33-9 -> 12007-33-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Boron sulfide not found on commonchemistry - Boron sulfide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Boron_triiodide (2128)
```
Botcommand: addindex 355551974 Boron_triiodide
```
```
For index : Boron_triiodide=355551974
```
* 13517-10-7 -> 13517-10-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Boron triiodide not found on commonchemistry - Boron triiodide

* ChemSpiderID: 75378 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 83546

* InChI: 1/BI3/c2-1(3)4 - (ChemSpider: | InChI=InChI=1/BI3/c2-1(3)4 )

* SMILES: IB(I)I - (ChemSpider: | SMILES=IB(I)I )
Bosseopentaenoic_acid (2132)
```
Botcommand: addindex 271408919 Bosseopentaenoic_acid
```
```
For index : Bosseopentaenoic_acid=271408919
```
* 133205-91-1 -> 133205-91-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Bosseopentaenoic acid not found on commonchemistry - Bosseopentaenoic acid

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O=C(O)CCCCCCC/C=C/C=C/C=C\CCCC
Bosutinib (2133)
```
Botcommand: addindex 361679187 Bosutinib
```
```
For index : Bosutinib=361679187
```
* 380843-75-4 -> 380843-75-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Bosutinib not found on commonchemistry - Bosutinib

* No ChemSpiderID

* PubChem: 5328940

* No InChI

* No SMILES
Botrydial (2134)
```
Botcommand: addindex 356143216 Botrydial
```
```
For index : Botrydial=356143216
```
* 54986-75-3 -> 54986-75-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Botrydial not found on commonchemistry - Botrydial

* No ChemSpiderID

* PubChem: 185781

* No InChI

* No SMILES
Botulinum_toxin (2135)
```
Botcommand: addindex 365071540 Botulinum_toxin
```
```
For index : Botulinum_toxin=365071540
```
* 93384-43-1 -> 93384-43-1 - NOT VERIFIED

* CAS found on commonchemistry - 93384-43-1 - name in list
All names: AGN 191622, Allergan, Allergan (toxin), Botox, Botox Cosmetic, Botulin A, Botulin neurotoxin A, Botulin toxin A, Botulinium toxin type A, Botulinum neurotoxin A, Botulinum toxin, Botulinum toxin A, Botulinum toxin type A, CBTX-A, Dysport, Linurase, Nc 224, Nc 270, Neuronox, NT 201, NT 201 (toxin), Oculinum, Onaclostox, Reloxin, toxinas, botulina, A, Toxine, Botulin-, A, toxines de botuline A, Toxins, botulin, A, Vistabel, Xeomin

* Botulinum toxin found on commonchemistry - Botulinum toxin
* 93384-43-1 (Formula: Unspecified; Name: Botulin A) Matches CAS (93384-43-1) on page

* 93384-44-2 (Formula: Unspecified; Name: Botulin B)

* No ChemSpiderID

* PubChem: 5485225

* No InChI

* No SMILES
Bourgeonal (2136)
```
Botcommand: addindex 332837885 Bourgeonal
```
```
For index : Bourgeonal=332837885
```
* 18127-01-0 -> 18127-01-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Bourgeonal not found on commonchemistry - Bourgeonal

* ChemSpiderID: 58364 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 64832

* InChI: 1/C13H18O/c1-13(2,3)12-8-6-11(7-9-12)5-4-10-14/h6-10H,4-5H2,1-3H3 - (ChemSpider: | InChI=InChI=1/C13H18O/c1-13(2,3)12-8-6-11(7-9-12)5-4-10-14/h6-10H,4-5H2,1-3H3 )

* SMILES: O=CCCc1ccc(cc1)C(C)(C)C - (ChemSpider: | SMILES=O=CCCc1ccc(cc1)C(C)(C)C )
Bradykinin (2137)
```
Botcommand: addindex 364841487 Bradykinin
```
```
For index : Bradykinin=364841487
```
* 58-82-2 -> 58-82-2 - NOT VERIFIED

* CAS found on commonchemistry - 58-82-2 - name in list
All names: 1: PN: JP2005049164 SEQID: 1 claimed protein, 1: PN: US20040198666 SEQID: 1 unclaimed protein, 1: PN: US20040220110 PAGE: 2 unclaimed protein, 1: PN: US20070015715 SEQID: 1 unclaimed sequence, 1: PN: WO02102835 SEQID: 3 unclaimed protein, 1: PN: WO2006130718 SEQID: 1 unclaimed protein, 1: PN: WO2006134125 SEQID: 22 claimed protein, 10: PN: WO2008008766 SEQID: 124 unclaimed sequence, 1021: PN: WO2006091861 SEQID: 1021 claimed protein, 107: PN: WO2006069765 SEQID: 107 claimed protein, 11: PN: US20040209344 SEQID: 7 unclaimed protein, 13: PN: WO0023092 SEQID: 13 unclaimed protein, 14: PN: US6525021 SEQID: 13 unclaimed protein, 147: PN: US20030119021 SEQID: 25 unclaimed protein, 15: PN: US6258776 SEQID: 24 unclaimed protein, 15: PN: WO2007058336 SEQID: 15 claimed sequence, 153: PN: WO2006067198 SEQID: 165 claimed protein, 16: PN: WO2006079099 SEQID: 1 unclaimed protein, 165: PN: US20050175581 SEQID: 165 unclaimed protein, 175: PN: WO2008008805 SEQID: 178 unclaimed protein, 18: PN: JP2006280210 SEQID: 18 unclaimed protein, 187: PN: US20030176421 PAGE: 54-55 claimed protein, 19: PN: US20060223140 SEQID: 18 claimed protein, 19: PN: WO2007022248 SEQID: 19 claimed protein, 2: PN: WO2005042027 SEQID: 1 unclaimed protein, 2: PN: WO2005057221 PAGE: 17 unclaimed protein, 3: PN: WO02059343 SEQID: 3 unclaimed protein, 3: PN: WO2006050091 SEQID: 7 claimed protein, 38: PN: WO2006017688 SEQID: 38 unclaimed protein, 4: PN: WO2008005084 SEQID: 7 unclaimed sequence, 41: PN: WO03028666 SEQID: 38 unclaimed protein, 57: PN: FR2862981 SEQID: 57 unclaimed protein, 57: PN: WO2004033476 SEQID: 57 unclaimed protein, 6: PN: US6395513 SEQID: 9 unclaimed protein, 6: PN: WO0112656 SEQID: 47 unclaimed protein, 7: PN: US20040170685 SEQID: 7 unclaimed protein, 7: PN: WO2008000803 PAGE: 40 claimed sequence, 8: PN: WO2004069857 PAGE: 49 unclaimed protein, 9: PN: US20060013855 SEQID: 9 unclaimed protein, 9: PN: WO2004068928 PAGE: 65 unclaimed protein, 9: PN: WO2005097186 SEQID: 9 claimed protein, [[Arginine, N2-[N-[1-[N-[N-[N-[1-(1-arginyl-L-prolyl)-L-prolyl]glycyl]-3-phenylalanyl]seryl]prolyl]-3-phenylalanyl]-]], bradiquinina, Bradykinin, Bradykinin (human), bradykinine, BRS 640, Callidin I, Kallidin 9, Kallidin I, L-Arginine, L-arginyl-L-prolyl-L-prolylglycyl-L-phenylalanyl-L-seryl-L-prolyl-L-phenylalanyl-, L-Bradykinin, Synthetic bradykinin

* Bradykinin found on commonchemistry - Bradykinin
* 58-82-2 (Formula: C50H73N15O11; Name: Bradykinin) Matches CAS (58-82-2) on page

* 9001-01-8 (Formula: Unspecified; Name: Kallikrein)

* No ChemSpiderID

* PubChem: 6026

* No InChI

* No SMILES
Brassinolide (2141)
```
Botcommand: addindex 336062617 Brassinolide
```
```
For index : Brassinolide=336062617
```
* 72962-43-7 -> 72962-43-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Brassinolide not found on commonchemistry - Brassinolide

* No ChemSpiderID

* PubChem: 5458706

* No InChI

* SMILES: O=C3OC[C@H]2[C@@H]1CC[C@@H]([C@@]1(C)CC[C@@H]2[C@@]4(C)C[C@@H](O)[C@@H](O)C[C@H]34)[C@H](C)[C@@H](O)[C@H](O)[C@@H](C)C(C)C
Brazilin (2142)
```
Botcommand: addindex 355914064 Brazilin
```
```
For index : Brazilin=355914064
```
* 474-07-7 -> 474-07-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Brazilin found on commonchemistry - Brazilin
* 517-28-2 (exact match)
Name in list

All names: ( )-Hematoxylin, [[7,11b-Dihydrobenz[b]indeno[1,2-b]pyran-3,4,6a,9,10(6H)-pentol]], [[Benz[b]indeno[1,2-d]pyran-3,4,6a,9,10(6H)-pentol, 7,11b-dihydro-]], [[Benz[b]indeno[1,2-d]pyran-3,4,6a,9,10(6H)-pentol, 7,11b-dihydro-, (6aS,11bR)-]], [[Benz[b]indeno[1,2-d]pyran-3,4,6a,9,10(6H)-pentol, 7,11b-dihydro-, (6aS-cis)-]], [[Benz[b]indeno[1,2-d]pyran-3,4,6a,9,10(6H)-pentol, 7,11b-dihydro-, cis-( )-]], haematoxylin, HAEMATOXYLINE POWDER, hematoxilina, Hematoxylin, Hematoxyline, Hematoxyline, Hydroxybrasilin, [[Hydroxybrazilin]], NSC 270085

* No ChemSpiderID

* PubChem: 73384

* No InChI

* SMILES: C1C2=CC(=C(C=C2[C@H]3[C@@]1(COC4=C3C=CC(=C4)O)O)O)O
Brecanavir (2143)
```
Botcommand: addindex 329892743 Brecanavir
```
```
For index : Brecanavir=329892743
```
* 313682-08-5 -> 313682-08-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Brecanavir not found on commonchemistry - Brecanavir

* No ChemSpiderID

* PubChem: 5743186

* No InChI

* No SMILES
Bremazocine (2145)
```
Botcommand: addindex 360227975 Bremazocine
```
```
For index : Bremazocine=360227975
```
* 75684-07-0 -> 75684-07-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Bremazocine not found on commonchemistry - Bremazocine

* ChemSpiderID: 1186 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 1223

* No InChI - (ChemSpider: | InChI=InChI=1/C20H29NO2/c1-4-20-9-10-21(13-19(23)7-8-19)17(18(20,2)3)11-14-5-6-15(22)12-16(14)20/h5-6,12,17,22-23H,4,7-11,13H2,1-3H3 )

* No SMILES - (ChemSpider: | smiles=OC1(CC1)CN4C3Cc2c(cc(O)cc2)C(C3(C)C)(CC4)CC )
Brentuximab_vedotin (2147)
```
Botcommand: addindex 349286390 Brentuximab_vedotin
```
```
For index : Brentuximab_vedotin=349286390
```
* 914088-09-8 -> 914088-09-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Brentuximab vedotin not found on commonchemistry - Brentuximab vedotin

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Bretazenil (2148)
```
Botcommand: addindex 360900493 Bretazenil
```
```
For index : Bretazenil=360900493
```
* 84379-13-5 -> 84379-13-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Bretazenil not found on commonchemistry - Bretazenil

* ChemSpiderID: 97049 (correct: 97049) - CORRECT - Retrieved data from ChemSpider

* PubChem: 107926

* No InChI - (ChemSpider: | InChI=InChI=1/C19H20BrN3O3/c1-19(2,3)26-18(25)15-16-13-8-5-9-22(13)17(24)14-11(20)6-4-7-12(14)23(16)10-21-15/h4,6-7,10,13H,5,8-9H2,1-3H3/t13-/m0/s1 )

* No SMILES - (ChemSpider: | smiles=O=C(OC(C)(C)C)c1ncn2c4c(C(=O)N3[C@H](c12)CCC3)c(Br)ccc4 )
Brevianamide_A_and_B (2150)
* No CASNo

* Search for Brevianamide_A_and_B did not give understandable results - Brevianamide A and B

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES

2151 to 2200

Briakinumab (2151)
```
Botcommand: addindex 345927699 Briakinumab
```
```
For index : Briakinumab=345927699
```
* 339308-60-0 -> 339308-60-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Briakinumab not found on commonchemistry - Briakinumab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Brickellin (2152)
```
Botcommand: addindex 350681598 Brickellin
```
```
For index : Brickellin=350681598
```
* 90357-63-4 -> 90357-63-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Brickellin not found on commonchemistry - Brickellin

* No ChemSpiderID

* PubChem: 13871363

* No InChI

* SMILES: COC1=C(C=C(C(=C1)C2=C(C(=O)C3=C(C(=C(C=C3O2)OC)OC)O)OC)O)OC
Brifentanil (2153)
```
Botcommand: addindex 343842648 Brifentanil
```
```
For index : Brifentanil=343842648
```
* 101345-71-5 -> 101345-71-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Brifentanil not found on commonchemistry - Brifentanil

* ChemSpiderID: 54682 (correct: 54682) - CORRECT - Retrieved data from ChemSpider

* PubChem: 60672

* No InChI - (ChemSpider: | InChI=InChI=1/C20H29FN6O3/c1-4-25-20(29)26(23-22-25)12-11-24-10-9-17(15(2)13-24)27(19(28)14-30-3)18-8-6-5-7-16(18)21/h5-8,15,17H,4,9-14H2,1-3H3/t15-,17 /m1/s1 )

* No SMILES - (ChemSpider: | smiles=Fc1ccccc1N(C(=O)COC)[C@H]3CCN(CCN2\N=N/N(C2=O)CC)C[C@H]3C )
Brilliant_Black_BN (2154)

* No CASNo

* Brilliant Black BN not found on commonchemistry - Brilliant Black BN

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Brilliant_Green_(dye) (2156)
```
Botcommand: addindex 364346078 Brilliant_Green_(dye)
```
```
For index : Brilliant_Green_(dye)=364346078
```
* 633-03-4 -> 633-03-4 - NOT VERIFIED

* CAS found on commonchemistry - 633-03-4 - name not in list
All names: [[[4-[4-(Diethylamino)benzhydrylen]cyclohexa-2,5-dien-1-yliden]diethylammoniumhydrogensulfat]], [[[4-[4-(diethylamino)benzhydrylene]cyclohexa-2,5-dien-1-ylidene]diethylammonium hydrogen sulphate]], 12415 Green, ADC Brilliant Green Crystals, Aizen Diamond Green GH, Aizen Malachite Green GH, Astra Diamond Green GX, Astrazon Green D, Avon Green A 4379, Basic Bright Green, Basic Bright Green Sulfate, Basic Brilliant Green, Basic Green 1, Basic Green V, BRILLIANT GREEN, Brilliant green aseptic, Brilliant Green B, Brilliant Green BP, Brilliant Green BP Crystals, Brilliant Green BPC, Brilliant Green Crystals, Brilliant Green Crystals H, Brilliant Green DSC, Brilliant Green G, Brilliant Green GX, Brilliant Green Lake, Brilliant Green P, Brilliant Green Special, Brilliant Green Sulfate, Brilliant Green WP Crystals, Brilliant Green Y, Brilliant Green YN, Brilliant Green YNS, Brilliant Lake Green Y, C.I. 42040, C.I. basic green 001, C.I. BASIC GREEN 1, Calcozine Brilliant Green G, Deorlene Green JJO, Diamond Green G, Diamond Green GH, [[Ethanaminium, N-[4-[[4-(diethylamino)phenyl]phenylmethylene]-2,5-cyclohexadien-1-ylidene]-N-ethyl-, sulfate (1:1)]], Ethyl green, Fast Green J, Fast Green JJO, Green EN, Hidaco Brilliant Green, [[hidrogenosulfato de [4-[4-(dietilamino)bencidrilen]ciclohexa-2,5-dien-1-iliden]dietilamonio]], [[Hydrogenosulfate de [4-[4-(diethylamino)benzhydrylene]cyclohexa-2,5-dien-1-ylidene]diethylammonium]], [[hydrogenosulfate de [4-[4-(diethylamino)benzhydrylene]cyclohexa-2,5-diene-1-ylidene]diethylammonium]], Malachite Green G, Mitsui Brilliant Green GX, NSC 5011, Resplendency Green, Solid Green, Tertrophene Brilliant Green G, Tokyo Aniline Brilliant Green

* Brilliant Green dye not found on commonchemistry - Brilliant Green dye

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Brinase (2158)
* No CASNo

* Brinase found on commonchemistry - Brinase
* 9001-90-5 (Formula: Unspecified; Name: Plasmin)

* 9001-92-7 (Formula: Unspecified; Name: Proteinase)

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Brivaracetam (2160)

* No CASNo

* Brivaracetam not found on commonchemistry - Brivaracetam

* ChemSpiderID: 8012964 (correct: 8012964) - CORRECT - Retrieved data from ChemSpider

* PubChem: 9837243

* InChI: 1/C11H20N2O2/c1-3-5-8-6-10(14)13(7-8)9(4-2)11(12)15/h8-9H,3-7H2,1-2H3,(H2,12,15)/t8-,9 /m1/s1 - (ChemSpider: | InChI=InChI=1/C11H20N2O2/c1-3-5-8-6-10(14)13(7-8)9(4-2)11(12)15/h8-9H,3-7H2,1-2H3,(H2,12,15)/t8-,9 /m1/s1 )

* SMILES: O=C(N)[C@@H](N1C(=O)C[C@@H](CCC)C1)CC - (ChemSpider: | SMILES=O=C(N)[C@@H](N1C(=O)C[C@@H](CCC)C1)CC )
Brivudine (2161)
```
Botcommand: addindex 343084139 Brivudine
```
```
For index : Brivudine=343084139
```
* 69304-47-8 -> 69304-47-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Brivudine not found on commonchemistry - Brivudine

* ChemSpiderID: 394011 (correct: 394011) - CORRECT - Retrieved data from ChemSpider

* PubChem: 446727

* No InChI - (ChemSpider: | InChI=InChI=1/C11H13BrN2O5/c12-2-1-6-4-14(11(18)13-10(6)17)9-3-7(16)8(5-15)19-9/h1-2,4,7-9,15-16H,3,5H2,(H,13,17,18)/b2-1 /t7-,8 ,9 /m0/s1 )

* No SMILES - (ChemSpider: | smiles=Br[C@H]=CC=1C(=O)NC(=O)N(C=1)[C@@H]2O[C@@H]([C@@H](O)C2)CO )
Brodimoprim (2163)
```
Botcommand: addindex 337182028 Brodimoprim
```
```
For index : Brodimoprim=337182028
```
* 56518-41-3 -> 56518-41-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Brodimoprim not found on commonchemistry - Brodimoprim

* ChemSpiderID: 62004 (correct: 62004) - CORRECT - Retrieved data from ChemSpider

* PubChem: 68760

* No InChI - (ChemSpider: | InChI=InChI=1/C13H15BrN4O2/c1-19-9-4-7(5-10(20-2)11(9)14)3-8-6-17-13(16)18-12(8)15/h4-6H,3H2,1-2H3,(H4,15,16,17,18) )

* No SMILES - (ChemSpider: | smiles=Brc1c(OC)cc(cc1OC)Cc2cnc(nc2N)N )
Brofaromine (2164)
```
Botcommand: addindex 348267421 Brofaromine
```
```
For index : Brofaromine=348267421
```
* 63638-91-5 -> 63638-91-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Brofaromine not found on commonchemistry - Brofaromine

* ChemSpiderID: 40549 (correct: 40549) - CORRECT - Retrieved data from ChemSpider

* PubChem: 44571

* No InChI - (ChemSpider: | InChI=InChI=1/C14H16BrNO2/c1-17-11-6-10-7-13(9-2-4-16-5-3-9)18-14(10)12(15)8-11/h6-9,16H,2-5H2,1H3 )

* No SMILES - (ChemSpider: | smiles=Brc3cc(OC)cc1c3oc(c1)C2CCNCC2 )
Bromadiolone (2166)
```
Botcommand: addindex 353447863 Bromadiolone
```
```
For index : Bromadiolone=353447863
```
* 28772-56-7 -> 28772-56-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Bromadiolone not found on commonchemistry - Bromadiolone

* ChemSpiderID: 10606098 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 34322

* InChI: 1/C30H23BrO4/c31-23-16-14-20(15-17-23)19-10-12-22(13-11-19)26(32)18-25(21-6-2-1-3-7-21)28-29(33)24-8-4-5-9-27(24)35-30(28)34/h1-17,25-26,32-33H,18H2 - (ChemSpider: | InChI=InChI=1/C30H23BrO4/c31-23-16-14-20(15-17-23)19-10-12-22(13-11-19)26(32)18-25(21-6-2-1-3-7-21)28-29(33)24-8-4-5-9-27(24)35-30(28)34/h1-17,25-26,32-33H,18H2 )

* SMILES: Brc1ccc(cc1)c2ccc(cc2)C(O)CC(C\3=C(/O)c4ccccc4OC/3=O)c5ccccc5 - (ChemSpider: | SMILES=Brc1ccc(cc1)c2ccc(cc2)C(O)CC(C\3=C(/O)c4ccccc4OC/3=O)c5ccccc5 )
Bromadoline (2167)
```
Botcommand: addindex 353002735 Bromadoline
```
```
For index : Bromadoline=353002735
```
* 67579-24-2 -> 67579-24-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Bromadoline not found on commonchemistry - Bromadoline

* No ChemSpiderID

* PubChem: ?

* No InChI

* No SMILES
Bromantane (2168)
```
Botcommand: addindex 347002162 Bromantane
```
```
For index : Bromantane=347002162
```
* 87913-26-6 -> 87913-26-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Bromantane not found on commonchemistry - Bromantane

* No ChemSpiderID

* PubChem: 4660557

* No InChI

* No SMILES
Bromazine (2170)
```
Botcommand: addindex 349569953 Bromazine
```
```
For index : Bromazine=349569953
```
* 1808-12-4 -> 1808-12-4 - NOT VERIFIED

* CAS found on commonchemistry - 1808-12-4 - name in list
All names: 2-(4-Bromodiphenylmethoxy)ethyldimethylamine hydrochloride, [[2-[(4-bromophenyl)phenylmethoxy]ethyl(dimethyl)ammonium chloride]], [[2-[(4-Bromphenyl)phenylmethoxy]ethyl(dimethyl)ammoniumchlorid]], 4-Bromo-Î±-phenylbenzyl 2-dimethylaminoethyl ether hydrochloride, Ambodryl hydrochloride, Bromazine hydrochloride, Bromdiphenhydramine hydrochloride, Bromdiphenylhydramine hydrochloride, Bromodiphenhydramine hydrochloride, [[chlorure de 2-[(4-bromophenyl)phenylmethoxy]ethyl(dimethyl)ammonium]], [[cloruro de 2-[(4-bromofenil)fenilmetoxi]etil(dimetil)amonio]], [[Ethanamine, 2-[(4-bromophenyl)phenylmethoxy]-N,N-dimethyl-, hydrochloride]], [[Ethanamine, 2-[(4-bromophenyl)phenylmethoxy]-N,N-dimethyl-, hydrochloride (1:1)]], [[Ethylamine, 2-[(p-bromo-Î±-phenylbenzyl)oxy]-N,N-dimethyl-, hydrochloride]], NSC 36113, Î²-(p-Bromobenzhydryloxy)ethyldimethylamine hydrochloride

* Bromazine found on commonchemistry - Bromazine
* 1808-12-4 (exact match) Matches CAS (1808-12-4) on page
Name in list

All names: 2-(4-Bromodiphenylmethoxy)ethyldimethylamine hydrochloride, [[2-[(4-bromophenyl)phenylmethoxy]ethyl(dimethyl)ammonium chloride]], [[2-[(4-Bromphenyl)phenylmethoxy]ethyl(dimethyl)ammoniumchlorid]], 4-Bromo-Î±-phenylbenzyl 2-dimethylaminoethyl ether hydrochloride, Ambodryl hydrochloride, [[bromazine hydrochloride]], Bromdiphenhydramine hydrochloride, Bromdiphenylhydramine hydrochloride, Bromodiphenhydramine hydrochloride, [[chlorure de 2-[(4-bromophenyl)phenylmethoxy]ethyl(dimethyl)ammonium]], [[cloruro de 2-[(4-bromofenil)fenilmetoxi]etil(dimetil)amonio]], [[Ethanamine, 2-[(4-bromophenyl)phenylmethoxy]-N,N-dimethyl-, hydrochloride]], [[Ethanamine, 2-[(4-bromophenyl)phenylmethoxy]-N,N-dimethyl-, hydrochloride (1:1)]], [[Ethylamine, 2-[(p-bromo-Î±-phenylbenzyl)oxy]-N,N-dimethyl-, hydrochloride]], NSC 36113, Î²-(p-Bromobenzhydryloxy)ethyldimethylamine hydrochloride

* ChemSpiderID: 2350 (correct: 2350) - CORRECT - Retrieved data from ChemSpider

* PubChem: 2444

* No InChI - (ChemSpider: | InChI=InChI=1/C17H20BrNO/c1-19(2)12-13-20-17(14-6-4-3-5-7-14)15-8-10-16(18)11-9-15/h3-11,17H,12-13H2,1-2H3 )

* No SMILES - (ChemSpider: | smiles=Brc1ccc(cc1)C(OCCN(C)C)c2ccccc2 )
Bromhexine (2173)
```
Botcommand: addindex 360413132 Bromhexine
```
```
For index : Bromhexine=360413132
```
* 3572-43-8 -> 3572-43-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Bromhexine not found on commonchemistry - Bromhexine

* ChemSpiderID: 2348 (correct: 2348) - CORRECT - Retrieved data from ChemSpider

* PubChem: 2442

* No InChI - (ChemSpider: | InChI=InChI=1/C14H20Br2N2/c1-18(12-5-3-2-4-6-12)9-10-7-11(15)8-13(16)14(10)17/h7-8,12H,2-6,9,17H2,1H3 )

* No SMILES - (ChemSpider: | smiles=Brc1cc(c(N)c(Br)c1)CN(C)C2CCCCC2 )
Bromic_acid (2174)
```
Botcommand: addindex 362317249 Bromic_acid
```
```
For index : Bromic_acid=362317249
```
* 7789-31-3 -> 7789-31-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Bromic acid found on commonchemistry - Bromic acid
* 7758-01-2 (Formula: BrHO3.K; Name: Bromic acid, potassium salt)

* 7789-38-0 (Formula: BrHO3.Na; Name: Bromic acid, sodium salt)

* 10035-10-6 (Formula: BrH; Name: Hydrobromic acid)

* 12124-97-9 (Formula: BrH4N; Name: Ammonium bromide, ((NH4)Br))

* 15541-45-4 (Formula: BrO3; Name: Bromate)

* ChemSpiderID: 22853 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 24445

* InChI: 1/BrHO3/c2-1(3)4/h(H,2,3,4) - (ChemSpider: | InChI=InChI=1/BrHO3/c2-1(3)4/h(H,2,3,4) )

* SMILES: O=Br(=O)O - (ChemSpider: | SMILES=O=Br(=O)O )
Bromine_dioxide (2175)
```
Botcommand: addindex 359884874 Bromine_dioxide
```
```
For index : Bromine_dioxide=359884874
```
* 21255-83-4 -> 21255-83-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Bromine dioxide not found on commonchemistry - Bromine dioxide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Bromine_monochloride (2176)
```
Botcommand: addindex 362766897 Bromine_monochloride
```
```
For index : Bromine_monochloride=362766897
```
* 13863-41-7 -> 13863-41-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Bromine monochloride not found on commonchemistry - Bromine monochloride

* ChemSpiderID: 55600 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/BrCl/c1-2 - (ChemSpider: | InChI=InChI=1/BrCl/c1-2 )

* SMILES: BrCl - (ChemSpider: | SMILES=BrCl )
Bromine_pentafluoride (2177)
```
Botcommand: addindex 362394577 Bromine_pentafluoride
```
```
For index : Bromine_pentafluoride=362394577
```
* 7789-30-2 -> 7789-30-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Bromine pentafluoride not found on commonchemistry - Bromine pentafluoride

* No ChemSpiderID

* PubChem: 24606

* InChI: InChI=1S/BrF5/c2-1(3,4,5)6

* SMILES: FBr(F)(F)(F)F
Bromine_trifluoride (2178)

* No CASNo

* Bromine trifluoride not found on commonchemistry - Bromine trifluoride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Bromisoval (2179)
```
Botcommand: addindex 350072942 Bromisoval
```
```
For index : Bromisoval=350072942
```
* 496-67-3 -> 496-67-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Bromisoval not found on commonchemistry - Bromisoval

* ChemSpiderID: 2353 (correct: 2353) - CORRECT - Retrieved data from ChemSpider

* PubChem: 2447

* No InChI - (ChemSpider: | InChI=InChI=1/C6H11BrN2O2/c1-3(2)4(7)5(10)9-6(8)11/h3-4H,1-2H3,(H3,8,9,10,11) )

* No SMILES - (ChemSpider: | smiles=O=C(NC(=O)N)C(Br)C(C)C )
Bromo-DragonFLY (2180)
```
Botcommand: addindex 361659350 Bromo-DragonFLY
```
```
For index : Bromo-DragonFLY=361659350
```
* 502759-67-3 -> 502759-67-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Bromo DragonFLY not found on commonchemistry - Bromo DragonFLY

* No ChemSpiderID

* PubChem: 10544447

* No InChI

* SMILES: C[C@H](CC1=C2C=COC2=C(C3=C1OC=C3)Br)N
Bromoacetylalprenololmenthane (2183)

* No CASNo

* Bromoacetylalprenololmenthane not found on commonchemistry - Bromoacetylalprenololmenthane

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Bromobenzyl_cyanide (2186)
```
Botcommand: addindex 361940553 Bromobenzyl_cyanide
```
```
For index : Bromobenzyl_cyanide=361940553
```
* 5798-79-8 -> 5798-79-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Bromobenzyl cyanide not found on commonchemistry - Bromobenzyl cyanide

* ChemSpiderID: 20715 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/C8H6BrN/c9-8(6-10)7-4-2-1-3-5-7/h1-5,8H - (ChemSpider: | InChI=InChI=1/C8H6BrN/c9-8(6-10)7-4-2-1-3-5-7/h1-5,8H )

* SMILES: N#CC(Br)c1ccccc1 - (ChemSpider: | SMILES=N#CC(Br)c1ccccc1 )
Bromobimane (2187)
```
Botcommand: addindex 353871656 Bromobimane
```
```
For index : Bromobimane=353871656
```
* 71418-44-5 -> 71418-44-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Bromobimane not found on commonchemistry - Bromobimane

* No ChemSpiderID

* PubChem: 24885999

* No InChI

* No SMILES
Bromochlorodifluoromethane (2188)
```
Botcommand: addindex 363319814 Bromochlorodifluoromethane
```
```
For index : Bromochlorodifluoromethane=363319814
```
* 353-59-3 -> 353-59-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Bromochlorodifluoromethane not found on commonchemistry - Bromochlorodifluoromethane

* No ChemSpiderID

* PubChem: 9625

* InChI: 1/CBrClF2/c2-1(3,4)5

* SMILES: C(F)(F)(Cl)Br
Bromochlorofluoroiodomethane (2189)
```
Botcommand: addindex 363167982 Bromochlorofluoroiodomethane
```
```
For index : Bromochlorofluoroiodomethane=363167982
```
* 753-65-1 -> 753-65-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Bromochlorofluoroiodomethane not found on commonchemistry - Bromochlorofluoroiodomethane

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: FC(I)(Cl)Br
Bromochlorosalicylanilide (2191)
```
Botcommand: addindex 341847481 Bromochlorosalicylanilide
```
```
For index : Bromochlorosalicylanilide=341847481
```
* 3679-64-9 -> 3679-64-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Bromochlorosalicylanilide not found on commonchemistry - Bromochlorosalicylanilide

* ChemSpiderID: 69679 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 77254

* No InChI - (ChemSpider: | InChI=InChI=1/C13H9BrClNO2/c14-8-1-6-12(17)11(7-8)13(18)16-10-4-2-9(15)3-5-10/h1-7,17H,(H,16,18) )

* No SMILES - (ChemSpider: | smiles=Brc2cc(C(=O)Nc1ccc(Cl)cc1)c(O)cc2 )
Bromocresol_purple (2193)
```
Botcommand: addindex 349804448 Bromocresol_purple
```
```
For index : Bromocresol_purple=349804448
```
* 115-40-2 -> 115-40-2 - NOT VERIFIED

* CAS found on commonchemistry - 115-40-2 - name in list
All names: 5,5'-Dibromo-o-cresol sulfophthalein, BROM CRESOL PURPLE, Bromcresol purple, Bromkresolpurpur, bromocresol purple, NSC 374134, [[o-Cresol, 4,4'-(3H-2,1-benzoxathiol-3-ylidene)bis[6-bromo-, S,S-dioxide]], o-Toluenesulfonic acid, Î±,Î±-bis(5-bromo-4-hydroxy-m-tolyl)-Î±-hydroxy-, Î³-sultone, [[Phenol, 4,4'-(1,1-dioxido-3H-2,1-benzoxathiol-3-ylidene)bis[2-bromo-6-methyl-]], [[Phenol, 4,4'-(3H-2,1-benzoxathiol-3-ylidene)bis[2-bromo-6-methyl-, S,S-dioxide]], [[Phenol, 4,4'-(3H-2,1-benzoxathiol-3-ylidene)bis[2-bromo-6-methyl-, S,S-dioxide]], Pourpre de bromocresol, purpura de bromocresol

* Bromocresol purple found on commonchemistry - Bromocresol purple
* 115-40-2 (exact match) Matches CAS (115-40-2) on page
Name in list

All names: 5,5'-Dibromo-o-cresol sulfophthalein, BROM CRESOL PURPLE, Bromcresol purple, Bromkresolpurpur, [[bromocresol purple]], NSC 374134, [[o-Cresol, 4,4'-(3H-2,1-benzoxathiol-3-ylidene)bis[6-bromo-, S,S-dioxide]], o-Toluenesulfonic acid, Î±,Î±-bis(5-bromo-4-hydroxy-m-tolyl)-Î±-hydroxy-, Î³-sultone, [[Phenol, 4,4'-(1,1-dioxido-3H-2,1-benzoxathiol-3-ylidene)bis[2-bromo-6-methyl-]], [[Phenol, 4,4'-(3H-2,1-benzoxathiol-3-ylidene)bis[2-bromo-6-methyl-, S,S-dioxide]], [[Phenol, 4,4'-(3H-2,1-benzoxathiol-3-ylidene)bis[2-bromo-6-methyl-, S,S-dioxide]], Pourpre de bromocresol, purpura de bromocresol

* No ChemSpiderID

* PubChem: 5286961

* No InChI

* SMILES: Cc1cc(cc(Br)c1O)C3(OS(=O)(=O)c2ccccc23)c4cc(C)c(O)c(Br)c4
Bromodifluoroacetyl_chloride (2198)
```
Botcommand: addindex 290822590 Bromodifluoroacetyl_chloride
```
```
For index : Bromodifluoroacetyl_chloride=290822590
```
* 3832-48-2 -> 3832-48-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Bromodifluoroacetyl chloride not found on commonchemistry - Bromodifluoroacetyl chloride

* No ChemSpiderID

* PubChem: 520892

* No InChI

* SMILES: C(=O)(C(F)(F)Br)Cl
Bromodifluoromethane (2199)
```
Botcommand: addindex 341847505 Bromodifluoromethane
```
```
For index : Bromodifluoromethane=341847505
```
* 1511-62-2 -> 1511-62-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Bromodifluoromethane not found on commonchemistry - Bromodifluoromethane

* No ChemSpiderID

* PubChem: 62407

* InChI: 1/CHBrF2/c2-1(3)4/h1H

* SMILES: C(F)(F)Br

2201 to 2250

Bromofluoromethane (2201)
```
Botcommand: addindex 341847550 Bromofluoromethane
```
```
For index : Bromofluoromethane=341847550
```
* 373-52-4 -> 373-52-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Bromofluoromethane not found on commonchemistry - Bromofluoromethane

* No ChemSpiderID

* PubChem: 61108

* InChI: 1/CH2BrF/c2-1-3/h1H2

* SMILES: C(F)Br
Bromoiodomethane (2203)
```
Botcommand: addindex 341847574 Bromoiodomethane
```
```
For index : Bromoiodomethane=341847574
```
* 557-68-6 -> 557-68-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Bromoiodomethane not found on commonchemistry - Bromoiodomethane

* No ChemSpiderID

* PubChem: 68407

* InChI: 1/CH2BrI/c2-1-3/h1H2

* SMILES: C(Br)I
Bromopentacarbonylrhenium(I) (2205)
```
Botcommand: addindex 355482374 Bromopentacarbonylrhenium(I)
```
```
For index : Bromopentacarbonylrhenium(I)=355482374
```
* 14220-21-4 -> 14220-21-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Bromopentacarbonylrhenium I not found on commonchemistry - Bromopentacarbonylrhenium I

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Bromopride (2207)
```
Botcommand: addindex 358881669 Bromopride
```
```
For index : Bromopride=358881669
```
* 4093-35-0 -> 4093-35-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Bromopride not found on commonchemistry - Bromopride

* ChemSpiderID: 2352 (correct: 2352) - CORRECT - Retrieved data from ChemSpider

* PubChem: 2446

* No InChI - (ChemSpider: | InChI=InChI=1/C14H22BrN3O2/c1-4-18(5-2)7-6-17-14(19)10-8-11(15)12(16)9-13(10)20-3/h8-9H,4-7,16H2,1-3H3,(H,17,19) )

* No SMILES - (ChemSpider: | smiles=Brc1cc(c(OC)cc1N)C(=O)NCCN(CC)CC )
Bromopyruvic_acid (2208)
```
Botcommand: addindex 295421207 Bromopyruvic_acid
```
```
For index : Bromopyruvic_acid=295421207
```
* 1113-59-3 -> 1113-59-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Bromopyruvic acid found on commonchemistry - Bromopyruvic acid
* 70-23-5 (exact match)
Name in list

All names: 3-Bromo-2-(oxo)propionic acid ethyl ester, 3-Bromo-2-oxopropanoic acid ethyl ester, [[3-bromopyruvic acid ethyl ester]], bromopiruvato de etilo, Bromopyruvate d'ethyle, [[bromopyruvic acid ethyl ester]], Ethyl 3-bromo-2-oxopropanoate, Ethyl 3-bromo-2-oxopropionate, Ethyl 3-bromopyruvate, ethyl bromopyruvate, Ethyl Î±-bromopyruvate, Ethylbrompyruvat, NSC 62182, Propanoic acid, 3-bromo-2-oxo-, ethyl ester, Pyruvic acid, bromo-, ethyl ester, [[Î²-bromopyruvic acid ethyl ester]]

* No ChemSpiderID

* PubChem: 70684

* No InChI

* SMILES: C(C(=O)C(=O)O)Br
Bromous_acid (2211)

* No CASNo

* Bromous acid not found on commonchemistry - Bromous acid

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Bromperidol (2213)
```
Botcommand: addindex 347012307 Bromperidol
```
```
For index : Bromperidol=347012307
```
* 10457-90-6 -> 10457-90-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Bromperidol not found on commonchemistry - Bromperidol

* ChemSpiderID: 2354 (correct: 2354) - CORRECT - Retrieved data from ChemSpider

* PubChem: 2448

* No InChI - (ChemSpider: | InChI=InChI=1/C21H23BrFNO2/c22-18-7-5-17(6-8-18)21(26)11-14-24(15-12-21)13-1-2-20(25)16-3-9-19(23)10-4-16/h3-10,26H,1-2,11-15H2 )

* No SMILES - (ChemSpider: | smiles=Fc1ccc(cc1)C(=O)CCCN3CCC(O)(c2ccc(Br)cc2)CC3 )
Bronidox (2216)
```
Botcommand: addindex 354965737 Bronidox
```
```
For index : Bronidox=354965737
```
* 30007-47-7 -> 30007-47-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Bronidox not found on commonchemistry - Bronidox

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Brooker's_merocyanine (2218)
```
Botcommand: addindex 355888727 Brooker's_merocyanine
```
```
For index : Brooker's_merocyanine=355888727
```
* 23302-83-2 -> 23302-83-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Brooker s merocyanine not found on commonchemistry - Brooker s merocyanine

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Brophebarbital (2219)

* No CASNo

* Brophebarbital not found on commonchemistry - Brophebarbital

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Bropirimine (2220)
```
Botcommand: addindex 359228509 Bropirimine
```
```
For index : Bropirimine=359228509
```
* 56741-95-8 -> 56741-95-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Bropirimine not found on commonchemistry - Bropirimine

* ChemSpiderID: 58914 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* No InChI - (ChemSpider: | InChI=InChI=1/C10H8BrN3O/c11-7-8(6-4-2-1-3-5-6)13-10(12)14-9(7)15/h1-5H,(H3,12,13,14,15) )

* No SMILES - (ChemSpider: | smiles=Br\C2=C(/c1ccccc1)N\C(=N/C2=O)N )
Brotizolam (2221)
```
Botcommand: addindex 365064852 Brotizolam
```
```
For index : Brotizolam=365064852
```
* 57801-81-7 -> 57801-81-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Brotizolam not found on commonchemistry - Brotizolam

* ChemSpiderID: 2357 (correct: 2357) - CORRECT - Retrieved data from ChemSpider

* PubChem: 2451

* No InChI - (ChemSpider: | InChI=InChI=1/C15H10BrClN4S/c1-8-19-20-13-7-18-14(9-4-2-3-5-11(9)17)10-6-12(16)22-15(10)21(8)13/h2-6H,7H2,1H3 )

* No SMILES - (ChemSpider: | smiles=Clc4ccccc4C/2=N/Cc1nnc(n1c3sc(Br)cc\23)C )
Brown_HT (2222)
```
Botcommand: addindex 356749003 Brown_HT
```
```
For index : Brown_HT=356749003
```
* 4553-89-3 -> 4553-89-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Brown HT not found on commonchemistry - Brown HT

* ChemSpiderID: 21172062 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 6536776

* InChI: 1/C27H20N4O9S2.2Na/c32-14-15-13-22(30-28-20-9-11-23(41(35,36)37)18-7-3-1-5-16(18)20)27(34)25(26(15)33)31-29-21-10-12-24(42(38,39)40)19-8-4-2-6-17(19)21;;/h1-13,32-34H,14H2,(H,35,36,37)(H,38,39,40);;/q;2* 1/p-2 - (ChemSpider: | InChI=InChI=1/C27H20N4O9S2.2Na/c32-14-15-13-22(30-28-20-9-11-23(41(35,36)37)18-7-3-1-5-16(18)20)27(34)25(26(15)33)31-29-21-10-12-24(42(38,39)40)19-8-4-2-6-17(19)21;;/h1-13,32-34H,14H2,(H,35,36,37)(H,38,39,40);;/q;2* 1/p-2 )

* SMILES: [Na ].[Na ].Oc3c(cc(CO)c(O)c3N=Nc2ccc(c1ccccc12)S([O-])(=O)=O)N=Nc5ccc(c4ccccc45)S([O-])(=O)=O - (ChemSpider: | SMILES=[Na ].[Na ].Oc3c(cc(CO)c(O)c3N=Nc2ccc(c1ccccc12)S([O-])(=O)=O)N=Nc5ccc(c4ccccc45)S([O-])(=O)=O )
Broxaterol (2223)
```
Botcommand: addindex 350936025 Broxaterol
```
```
For index : Broxaterol=350936025
```
* 76596-57-1 -> 76596-57-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Broxaterol not found on commonchemistry - Broxaterol

* ChemSpiderID: 64294 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 71149

* InChI: 1/C9H15BrN2O2/c1-9(2,3)11-5-6(13)7-4-8(10)12-14-7/h4,6,11,13H,5H2,1-3H3 - (ChemSpider: | InChI=InChI=1/C9H15BrN2O2/c1-9(2,3)11-5-6(13)7-4-8(10)12-14-7/h4,6,11,13H,5H2,1-3H3 )

* SMILES: Brc1noc(c1)C(O)CNC(C)(C)C - (ChemSpider: | SMILES=Brc1noc(c1)C(O)CNC(C)(C)C )
Broxyquinoline (2224)
```
Botcommand: addindex 285979153 Broxyquinoline
```
```
For index : Broxyquinoline=285979153
```
* 521-74-4 -> 521-74-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Broxyquinoline not found on commonchemistry - Broxyquinoline

* No ChemSpiderID

* PubChem: 2453

* No InChI

* No SMILES
Brucellosis_vaccine (2225)
* No CASNo

* Brucellosis vaccine not found on commonchemistry - Brucellosis vaccine

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Brucine (2226)
```
Botcommand: addindex 363082409 Brucine
```
```
For index : Brucine=363082409
```
* 357-57-3 -> 357-57-3 - NOT VERIFIED

* CAS found on commonchemistry - 357-57-3 - name in list
All names: (-)-Brucine, 10,11-Dimethoxystrychnine, 2,3-Dimethoxystrychnidin-10-one, 2,3-Dimethoxystrychnine, 2,3-Dimethylstrychnine, Brucin, brucina, Brucine, BRUCINE ALKALOID, Dimethoxystrychnine, l-Brucine, Strychnidin-10-one, 2,3-dimethoxy, Strychnidin-10-one, 2,3-dimethoxy-, UN 1570, UN 1570

* Brucine found on commonchemistry - Brucine
* 357-57-3 (exact match) Matches CAS (357-57-3) on page
Name in list

All names: [[(-)-brucine]], 10,11-Dimethoxystrychnine, 2,3-Dimethoxystrychnidin-10-one, 2,3-Dimethoxystrychnine, 2,3-Dimethylstrychnine, Brucin, brucina, [[brucine]], [[brucine ALKALOID]], Dimethoxystrychnine, [[l-brucine]], Strychnidin-10-one, 2,3-dimethoxy, Strychnidin-10-one, 2,3-dimethoxy-, UN 1570, UN 1570

* ChemSpiderID: 390579 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 442021

* InChI: 1/C23H26N2O4/c1-27-16-8-14-15(9-17(16)28-2)25-20(26)10-18-21-13-7-19-23(14,22(21)25)4-5-24(19)11-12(13)3-6-29-18/h3,8-9,13,18-19,21-22H,4-7,10-11H2,1-2H3/t13-,18-,19-,21-,22-,23 /m0/s1 - (ChemSpider: | InChI=InChI=1/C23H26N2O4/c1-27-16-8-14-15(9-17(16)28-2)25-20(26)10-18-21-13-7-19-23(14,22(21)25)4-5-24(19)11-12(13)3-6-29-18/h3,8-9,13,18-19,21-22H,4-7,10-11H2,1-2H3/t13-,18-,19-,21-,22-,23 /m0/s1 )

* SMILES: O=C7N2c1cc(OC)c(OC)cc1[C@@]64[C@@H]2[C@@H]3[C@@H](OC/C=C5\[C@@H]3C[C@@H]6N(CC4)C5)C7 - (ChemSpider: | SMILES=O=C7N2c1cc(OC)c(OC)cc1[C@@]64[C@@H]2[C@@H]3[C@@H](OC/C=C5\[C@@H]3C[C@@H]6N(CC4)C5)C7 )
Bucillamine (2227)
```
Botcommand: addindex 351097126 Bucillamine
```
```
For index : Bucillamine=351097126
```
* 65002-17-7 -> 65002-17-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Bucillamine not found on commonchemistry - Bucillamine

* No ChemSpiderID

* PubChem: 2459

* No InChI

* No SMILES
Bucindolol (2228)
```
Botcommand: addindex 351858223 Bucindolol
```
```
For index : Bucindolol=351858223
```
* 71119-11-4 -> 71119-11-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Bucindolol not found on commonchemistry - Bucindolol

* ChemSpiderID: 46266 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 51045

* No InChI - (ChemSpider: | InChI=InChI=1/C22H25N3O2/c1-22(2,11-17-13-24-20-9-5-4-8-19(17)20)25-14-18(26)15-27-21-10-6-3-7-16(21)12-23/h3-10,13,18,24-26H,11,14-15H2,1-2H3 )

* No SMILES - (ChemSpider: | smiles=N#Cc3ccccc3OCC(O)CNC(C)(C)Cc2c1ccccc1nc2 )
Bucladesine (2229)
```
Botcommand: addindex 345526321 Bucladesine
```
```
For index : Bucladesine=345526321
```
* 362-74-3 -> 362-74-3 - NOT VERIFIED

* CAS found on commonchemistry - 362-74-3 - name in list
All names: 3',5'-Cyclic AMP dibutyrate, Actosin, Adenosine, N-(1-oxobutyl)-, cyclic 3',5'-(hydrogen phosphate) 2'-butanoate, Adenosine, N-(1-oxobutyl)-, cyclic 3',5'-(hydrogen phosphate) 2'-butanoate, Bucladesin, bucladesina, bucladesine, Butyramide, N-(9-Î²-D-ribofuranosyl-9H-purin-6-yl)-, 2'-butyrate, cyclic 3',5'-phosphate, Butyramide, N-(9-Î²-D-ribofuranosyl-9H-purin-6-yl)-, cyclic 3',5'-(hydrogen phosphate) 2'-butyrate, Cyclic AMP dibutyrate, Cyclic AMP N6,2'-O-dibutyrate, Cyclic dibutyryl-AMP, dbcAMP, Dibutyryl 3',5'-cyclic adenosine monophosphate, Dibutyryl 3',5'-cyclic AMP, Dibutyryl cAMP, Dibutyryl cyclic 3',5'-adenylic acid, Dibutyryl cyclic 3',5'-AMP, Dibutyryl cyclic adenosine 3',5'-monophosphate, Dibutyryl cyclic adenosine monophosphate, Dibutyryl cyclic AMP, Dibutyryl-3',5'-adenosine monophosphate, Dibutyryl-3',5'-AMP, Dibutyryladenosine 3',5'-cyclic monophosphate, Dibutyryladenosine 3',5'-cyclic phosphate, Dibutyryladenosine 3',5'-cyclophosphate, Dibutyryladenosine 3',5'-monophosphate, Dibutyryladenosine cyclic 3',5'-monophosphate, Dibutyryladenosine cyclic monophosphate, DT 5621, N6,2'-Dibutyryladenosine cyclic 3',5'-(hydrogen phosphate), N6,2'-O-Dibutyryl 3',5'-cyclic adenosine monophosphate, N6,2'-O-Dibutyryl cAMP, N6,2'-O-Dibutyryl cyclic 3',5'-adenosine monophosphate, N6,2'-O-Dibutyryl cyclic 3',5'-AMP, N6,2'-O-Dibutyryl cyclic AMP, N6,2'-O-Dibutyryladenosine 3',5'-monophosphate, N6,2'-O-Dibutyryladenosine cyclic 3',5'-monophosphate, N6,2'-O-Dibutyryladenosine cyclic 3',5'-phosphate, N6,O2'-Dibutyryl 3',5'-AMP, N6,O2'-Dibutyryl adenosine 3',5'-cyclic monophosphate, N6,O2'-Dibutyryl adenosine-3',5'-phosphate, N6,O2'-Dibutyryl cyclic 3',5'-AMP, N6,O2'-Dibutyryl cyclic adenosine 3',5'-monophosphate, N6,O2'-Dibutyryl cyclic adenosine 3',5'-monophosphoric acid, N6,O2'-Dibutyryl cyclic adenosine monophosphate, N6,O2'-Dibutyryl cyclic AMP, N6,O2'-Dibutyryl-3',5'-cyclic AMP, N6,O2'-Dibutyryladenosine 3',5'-monophosphate, N6,O2'-Dibutyryladenosine cyclic 3',5'-phosphate, N6,O2'-Dibutyryl-cAMP, N6,O2'-Dibutyrylcyclic adenosine 3',5'-phosphate, N-6-2-O-Dibutyryl adenosine-3',5'-monophosphate, N6-2'-O-Dibutyryl-3',5'-AMP, NSC 143108

* Bucladesine found on commonchemistry - Bucladesine
* 362-74-3 (exact match) Matches CAS (362-74-3) on page
Name in list

All names: 3',5'-Cyclic AMP dibutyrate, Actosin, Adenosine, N-(1-oxobutyl)-, cyclic 3',5'-(hydrogen phosphate) 2'-butanoate, Adenosine, N-(1-oxobutyl)-, cyclic 3',5'-(hydrogen phosphate) 2'-butanoate, Bucladesin, bucladesina, [[bucladesine]], Butyramide, N-(9-Î²-D-ribofuranosyl-9H-purin-6-yl)-, 2'-butyrate, cyclic 3',5'-phosphate, Butyramide, N-(9-Î²-D-ribofuranosyl-9H-purin-6-yl)-, cyclic 3',5'-(hydrogen phosphate) 2'-butyrate, Cyclic AMP dibutyrate, Cyclic AMP N6,2'-O-dibutyrate, Cyclic dibutyryl-AMP, dbcAMP, Dibutyryl 3',5'-cyclic adenosine monophosphate, Dibutyryl 3',5'-cyclic AMP, Dibutyryl cAMP, Dibutyryl cyclic 3',5'-adenylic acid, Dibutyryl cyclic 3',5'-AMP, Dibutyryl cyclic adenosine 3',5'-monophosphate, Dibutyryl cyclic adenosine monophosphate, Dibutyryl cyclic AMP, Dibutyryl-3',5'-adenosine monophosphate, Dibutyryl-3',5'-AMP, Dibutyryladenosine 3',5'-cyclic monophosphate, Dibutyryladenosine 3',5'-cyclic phosphate, Dibutyryladenosine 3',5'-cyclophosphate, Dibutyryladenosine 3',5'-monophosphate, Dibutyryladenosine cyclic 3',5'-monophosphate, Dibutyryladenosine cyclic monophosphate, DT 5621, N6,2'-Dibutyryladenosine cyclic 3',5'-(hydrogen phosphate), N6,2'-O-Dibutyryl 3',5'-cyclic adenosine monophosphate, N6,2'-O-Dibutyryl cAMP, N6,2'-O-Dibutyryl cyclic 3',5'-adenosine monophosphate, N6,2'-O-Dibutyryl cyclic 3',5'-AMP, N6,2'-O-Dibutyryl cyclic AMP, N6,2'-O-Dibutyryladenosine 3',5'-monophosphate, N6,2'-O-Dibutyryladenosine cyclic 3',5'-monophosphate, N6,2'-O-Dibutyryladenosine cyclic 3',5'-phosphate, N6,O2'-Dibutyryl 3',5'-AMP, N6,O2'-Dibutyryl adenosine 3',5'-cyclic monophosphate, N6,O2'-Dibutyryl adenosine-3',5'-phosphate, N6,O2'-Dibutyryl cyclic 3',5'-AMP, N6,O2'-Dibutyryl cyclic adenosine 3',5'-monophosphate, N6,O2'-Dibutyryl cyclic adenosine 3',5'-monophosphoric acid, N6,O2'-Dibutyryl cyclic adenosine monophosphate, N6,O2'-Dibutyryl cyclic AMP, N6,O2'-Dibutyryl-3',5'-cyclic AMP, N6,O2'-Dibutyryladenosine 3',5'-monophosphate, N6,O2'-Dibutyryladenosine cyclic 3',5'-phosphate, N6,O2'-Dibutyryl-cAMP, N6,O2'-Dibutyrylcyclic adenosine 3',5'-phosphate, N-6-2-O-Dibutyryl adenosine-3',5'-monophosphate, N6-2'-O-Dibutyryl-3',5'-AMP, NSC 143108

* No ChemSpiderID

* PubChem: 28177

* No InChI

* No SMILES
Bucolome (2231)
```
Botcommand: addindex 292885612 Bucolome
```
```
For index : Bucolome=292885612
```
* 841-73-6 -> 841-73-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Bucolome not found on commonchemistry - Bucolome

* No ChemSpiderID

* PubChem: 2461

* No InChI

* No SMILES
Budesonide/formoterol (2233)
* No CASNo

* Budesonide formoterol not found on commonchemistry - Budesonide formoterol

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Budipine (2234)
```
Botcommand: addindex 337355920 Budipine
```
```
For index : Budipine=337355920
```
* 57982-78-2 -> 57982-78-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Budipine not found on commonchemistry - Budipine

* ChemSpiderID: 62021 (correct: 62021) - CORRECT - Retrieved data from ChemSpider

* PubChem: 68778

* No InChI - (ChemSpider: | InChI=InChI=1/C21H27N/c1-20(2,3)22-16-14-21(15-17-22,18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-13H,14-17H2,1-3H3 )

* No SMILES - (ChemSpider: | smiles=c1(ccccc1)C3(c2ccccc2)CCN(C(C)(C)C)CC3 )
Budralazine (2235)
```
Botcommand: addindex 337356168 Budralazine
```
```
For index : Budralazine=337356168
```
* 36798-79-5 -> 36798-79-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Budralazine not found on commonchemistry - Budralazine

* ChemSpiderID: 4925205 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 6419536

* No InChI - (ChemSpider: | InChI=InChI=1/C14H16N4/c1-10(2)8-11(3)16-18-14-13-7-5-4-6-12(13)9-15-17-14/h4-9H,1-3H3,(H,17,18)/b16-11 )

* No SMILES - (ChemSpider: | smiles=n2nc(c1ccccc1c2)N/N=C(/C=C(\C)C)C )
Bufadienolide (2236)

* No CASNo

* Bufadienolide not found on commonchemistry - Bufadienolide

* No ChemSpiderID

* PubChem: 3035030

* InChI: 1S/C24H34O2/c1-23-13-4-3-5-17(23)7-8-18-20-10-9-19(16-6-11-22(25)26-15-16)24(20,2)14-12-21(18)23/h6,11,15,17-21H,3-5,7-10,12-14H2,1-2H3/t17-,18-,19 ,20 ,21-,23-,24 /m0/s1

* SMILES: CC14CCC3C2(C)CCCCC2CCC3C1CCC4c5ccc(=O)oc5
Bufexamac (2237)
```
Botcommand: addindex 386336907 Bufexamac
```
```
For index : Bufexamac=386336907
```
* 2438-72-4 -> 2438-72-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Bufexamac not found on commonchemistry - Bufexamac

* No ChemSpiderID

* PubChem: 2466

* No InChI

* No SMILES
Buflomedil (2238)
```
Botcommand: addindex 345618186 Buflomedil
```
```
For index : Buflomedil=345618186
```
* 55837-25-7 -> 55837-25-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Buflomedil not found on commonchemistry - Buflomedil

* No ChemSpiderID

* PubChem: 2467

* No InChI

* SMILES: COC1=CC(=C(C(=C1)OC)C(=O)CCCN2CCCC2)OC
Buformin (2239)
```
Botcommand: addindex 359889326 Buformin
```
```
For index : Buformin=359889326
```
* 692-13-7 -> 692-13-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Buformin not found on commonchemistry - Buformin

* ChemSpiderID: 2374 (correct: 2374) - CORRECT - Retrieved data from ChemSpider

* PubChem: 2468

* No InChI - (ChemSpider: | InChI=InChI=1/C6H15N5/c1-2-3-4-10-6(9)11-5(7)8/h2-4H2,1H3,(H6,7,8,9,10,11) )

* No SMILES - (ChemSpider: | smiles=N(=C(/N)N)\C(=N\CCCC)N )
Bufotalin (2240)
```
Botcommand: addindex 364254867 Bufotalin
```
```
For index : Bufotalin=364254867
```
* 471-95-4 -> 471-95-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Bufotalin not found on commonchemistry - Bufotalin

* No ChemSpiderID

* PubChem: 10119

* No InChI

* SMILES: CC(=O)O[C@H]1C[C@@]2(C3CC[C@@H]4C[C@H](CC[C@@]4(C3CC[C@@]2([C@H]1C5=COC(=O)C=C5)C)C)O)O
Bufotenidine (2241)
```
Botcommand: addindex 360733047 Bufotenidine
```
```
For index : Bufotenidine=360733047
```
* 487-91-2 -> 487-91-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Bufotenidine not found on commonchemistry - Bufotenidine

* No ChemSpiderID

* PubChem: 3083591

* No InChI

* SMILES: C[N ](C)(C)CCC1=CNC2=C1C=C(C=C2)[O-]
Bufotenin (2242)
```
Botcommand: addindex 360221846 Bufotenin
```
```
For index : Bufotenin=360221846
```
* 487-93-4 -> 487-93-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Bufotenin not found on commonchemistry - Bufotenin

* ChemSpiderID: 9839 (correct: 9839) - CORRECT - Retrieved data from ChemSpider

* PubChem: 10257

* No InChI - (ChemSpider: | InChI=InChI=1/C12H16N2O/c1-14(2)6-5-9-8-13-12-4-3-10(15)7-11(9)12/h3-4,7-8,13,15H,5-6H2,1-2H3 )

* No SMILES - (ChemSpider: | smiles=Oc1cc2c(cc1)ncc2CCN(C)C )
Bulbocapnine (2243)
```
Botcommand: addindex 360971487 Bulbocapnine
```
```
For index : Bulbocapnine=360971487
```
* 298-45-3 -> 298-45-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Bulbocapnine not found on commonchemistry - Bulbocapnine

* ChemSpiderID: 11934 (correct: 11934) - CORRECT - Retrieved data from ChemSpider

* PubChem: 12441

* InChI: 1/C19H19NO4/c1-20-6-5-11-8-14-19(24-9-23-14)17-15(11)12(20)7-10-3-4-13(22-2)18(21)16(10)17/h3-4,8,12,21H,5-7,9H2,1-2H3/t12-/m0/s1 - (ChemSpider: | InChI=InChI=1/C19H19NO4/c1-20-6-5-11-8-14-19(24-9-23-14)17-15(11)12(20)7-10-3-4-13(22-2)18(21)16(10)17/h3-4,8,12,21H,5-7,9H2,1-2H3/t12-/m0/s1 )

* SMILES: O1c4c(OC1)c3c2c(O)c(OC)ccc2C[C@H]5c3c(c4)CCN5C - (ChemSpider: | SMILES=O1c4c(OC1)c3c2c(O)c(OC)ccc2C[C@H]5c3c(c4)CCN5C )
Bullvalene (2244)
```
Botcommand: addindex 364477528 Bullvalene
```
```
For index : Bullvalene=364477528
```
* 1005-51-2 -> 1005-51-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Bullvalene not found on commonchemistry - Bullvalene

* ChemSpiderID: 120549 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 136796

* InChI: 1/C10H10/c1-4-8-9-5-2-7(1)3-6-10(8)9/h1-10H - (ChemSpider: | InChI=InChI=1/C10H10/c1-4-8-9-5-2-7(1)3-6-10(8)9/h1-10H )

* SMILES: C\2=C\C/1\C=C/C3C(\C=C\1)C/23 - (ChemSpider: | SMILES=C\2=C\C/1\C=C/C3C(\C=C\1)C/23 )
Bumadizone (2245)

* No CASNo

* Bumadizone not found on commonchemistry - Bumadizone

* No ChemSpiderID

* PubChem: 19161

* No InChI

* No SMILES
Bunaftine (2247)
```
Botcommand: addindex 351661192 Bunaftine
```
```
For index : Bunaftine=351661192
```
* 32421-46-8 -> 32421-46-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Bunaftine not found on commonchemistry - Bunaftine

* ChemSpiderID: 33233 (correct: 33233) - CORRECT - Retrieved data from ChemSpider

* PubChem: 36131

* No InChI - (ChemSpider: | InChI=InChI=1/C21H30N2O/c1-4-7-15-23(17-16-22(5-2)6-3)21(24)20-14-10-12-18-11-8-9-13-19(18)20/h8-14H,4-7,15-17H2,1-3H3 )

* No SMILES - (ChemSpider: | smiles=O=C(N(CCCC)CCN(CC)CC)c2cccc1ccccc12 )
Bunazosin (2248)
```
Botcommand: addindex 353642160 Bunazosin
```
```
For index : Bunazosin=353642160
```
* 80755-51-7 -> 80755-51-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Bunazosin not found on commonchemistry - Bunazosin

* No ChemSpiderID

* PubChem: 2472

* No InChI

* No SMILES
Buparvaquone (2249)
```
Botcommand: addindex 347994858 Buparvaquone
```
```
For index : Buparvaquone=347994858
```
* 88426-33-9 -> 88426-33-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Buparvaquone not found on commonchemistry - Buparvaquone

* ChemSpiderID: 10807457 (correct: 10807457) - CORRECT - Retrieved data from ChemSpider

* No PubChem

* No InChI - (ChemSpider: | InChI=InChI=1/C21H26O3/c1-21(2,3)14-10-8-13(9-11-14)12-17-18(22)15-6-4-5-7-16(15)19(23)20(17)24/h4-7,13-14,24H,8-12H2,1-3H3 )

* No SMILES - (ChemSpider: | smiles=CC(C)(C)C3CCC(C\C2=C(/O)C(=O)c1ccccc1C2=O)CC3 )
Buphedrone (2250)
```
Botcommand: addindex 349916302 Buphedrone
```
```
For index : Buphedrone=349916302
```
* 408332-79-6 -> 408332-79-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Buphedrone not found on commonchemistry - Buphedrone

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES

User:Beetstra/listing9

Contents

Data

2001 to 2050

2051 to 2100

2101 to 2150

2151 to 2200

2201 to 2250